Attributes
UniProt ID
Protein Name
Glutathione S-transferase F9
Ligand Name
GLUTATHIONE SULFONIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWRMTHFAZVWAM-WDSKDSINSA-N
SMILES
C(CC(=O)NC(CS(=O)(=O)O)C(=O)NCC(=O)O)C(C(=O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6F01
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6f01A1e6f01A2e6f01B1e6f01B2
ECOD domains from experimental PDB structures interacting with ligand DB03003
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O80852 | DB03003 | GTS | 6f01 | e6f01A1 | A:2-80 |
| O80852 | DB03003 | GTS | 6f01 | e6f01A2 | A:81-213 |
| O80852 | DB03003 | GTS | 6f01 | e6f01B1 | B:81-213 |
| O80852 | DB03003 | GTS | 6f01 | e6f01B2 | B:2-80 |
| O80852 | DB03003 | GTS | 6f05 | e6f05A1 | A:81-213 |
| O80852 | DB03003 | GTS | 6f05 | e6f05A2 | A:2-80 |
| O80852 | DB03003 | GTS | 6f05 | e6f05B1 | B:81-215 |
| O80852 | DB03003 | GTS | 6f05 | e6f05B2 | B:2-80 |
| O80852 | DB03003 | GTS | 6f05 | e6f05C1 | C:81-213 |
| O80852 | DB03003 | GTS | 6f05 | e6f05C2 | C:2-80 |
| O80852 | DB03003 | GTS | 6f05 | e6f05D1 | D:81-213 |
| O80852 | DB03003 | GTS | 6f05 | e6f05D2 | D:2-80 |
| O80852 | DB03003 | GTS | 6f05 | e6f05E1 | E:81-213 |
| O80852 | DB03003 | GTS | 6f05 | e6f05E2 | E:2-80 |
| O80852 | DB03003 | GTS | 6f05 | e6f05F1 | F:81-213 |
| O80852 | DB03003 | GTS | 6f05 | e6f05F2 | F:2-80 |
| O80852 | DB03003 | GTS | 6f05 | e6f05G1 | G:81-212 |
| O80852 | DB03003 | GTS | 6f05 | e6f05G2 | G:3-80 |
| O80852 | DB03003 | GTS | 6f05 | e6f05H1 | H:81-213 |
| O80852 | DB03003 | GTS | 6f05 | e6f05H2 | H:2-80 |
| O80852 | DB03003 | GTS | 6f05 | e6f05I1 | I:81-213 |
| O80852 | DB03003 | GTS | 6f05 | e6f05I2 | I:2-80 |
| O80852 | DB03003 | GTS | 6f05 | e6f05J1 | J:2-80 |
| O80852 | DB03003 | GTS | 6f05 | e6f05J2 | J:81-212 |