Attributes
UniProt ID
Protein Name
Glycine receptor subunit alphaZ1
Ligand Name
(6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
CYQFCXCEBYINGO-IAGOWNOFSA-N
SMILES
CCCCCc1cc(c2c(c1)OC(C3C2C=C(CC3)C)(C)C)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7M6M
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7m6mA1e7m6mA2e7m6mB1e7m6mB2e7m6mC1e7m6mC2e7m6mD1e7m6mD2e7m6mE1e7m6mE2
ECOD domains from experimental PDB structures interacting with ligand DB00470
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O93430 | DB00470 | TCI | 7m6m | e7m6mA1 | A:244-334,A:401-441 |
| O93430 | DB00470 | TCI | 7m6m | e7m6mB2 | B:244-334,B:401-441 |
| O93430 | DB00470 | TCI | 7m6m | e7m6mC2 | C:244-334,C:401-441 |
| O93430 | DB00470 | TCI | 7m6m | e7m6mD2 | D:244-334,D:401-441 |
| O93430 | DB00470 | TCI | 7m6m | e7m6mE1 | E:244-334,E:401-441 |
| O93430 | DB00470 | TCI | 7m6o | e7m6oA1 | A:244-336,A:401-442 |
| O93430 | DB00470 | TCI | 7m6o | e7m6oB2 | B:244-336,B:401-442 |
| O93430 | DB00470 | TCI | 7m6o | e7m6oC2 | C:244-336,C:401-442 |
| O93430 | DB00470 | TCI | 7m6o | e7m6oD1 | D:244-336,D:401-442 |
| O93430 | DB00470 | TCI | 7m6o | e7m6oE1 | E:244-336,E:401-442 |
| O93430 | DB00470 | TCI | 7m6q | e7m6qA1 | A:244-336,A:401-442 |
| O93430 | DB00470 | TCI | 7m6q | e7m6qB1 | B:244-336,B:401-442 |
| O93430 | DB00470 | TCI | 7m6q | e7m6qC1 | C:244-336,C:401-442 |
| O93430 | DB00470 | TCI | 7m6q | e7m6qD2 | D:244-336,D:401-442 |
| O93430 | DB00470 | TCI | 7m6q | e7m6qE2 | E:244-336,E:401-442 |