Attributes
UniProt ID
Protein Name
Glucose 1-dehydrogenase
Ligand Name
NADP NICOTINAMIDE-ADENINE-DINUCLEOTIDE PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XJLXINKUBYWONI-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)OP(=O)(O)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2CDA
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2cdaA5e2cdaA6e2cdaB5e2cdaB6
ECOD domains from experimental PDB structures interacting with ligand DB03461
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O93715 | DB03461 | NAP | 2cda | e2cdaA5 | A:1-187,A:309-366 |
| O93715 | DB03461 | NAP | 2cda | e2cdaA6 | A:181-308 |
| O93715 | DB03461 | NAP | 2cda | e2cdaB5 | B:1-187,B:309-366 |
| O93715 | DB03461 | NAP | 2cda | e2cdaB6 | B:181-308 |
| O93715 | DB03461 | NAP | 2cdb | e2cdbA5 | A:1-187,A:309-366 |
| O93715 | DB03461 | NAP | 2cdb | e2cdbA6 | A:181-308 |
| O93715 | DB03461 | NAP | 2cdb | e2cdbB5 | B:1-187,B:309-366 |
| O93715 | DB03461 | NAP | 2cdb | e2cdbB6 | B:181-308 |
| O93715 | DB03461 | NAP | 2cdb | e2cdbC5 | C:1-187,C:309-366 |
| O93715 | DB03461 | NAP | 2cdb | e2cdbC6 | C:181-308 |
| O93715 | DB03461 | NAP | 2cdb | e2cdbD5 | D:1-187,D:309-366 |
| O93715 | DB03461 | NAP | 2cdb | e2cdbD6 | D:181-308 |
| O93715 | DB03461 | NAP | 2cdc | e2cdcA5 | A:1-187,A:309-366 |
| O93715 | DB03461 | NAP | 2cdc | e2cdcA6 | A:181-308 |
| O93715 | DB03461 | NAP | 2cdc | e2cdcB5 | B:1-187,B:309-366 |
| O93715 | DB03461 | NAP | 2cdc | e2cdcB6 | B:181-308 |
| O93715 | DB03461 | NAP | 2cdc | e2cdcC5 | C:1-187,C:309-366 |
| O93715 | DB03461 | NAP | 2cdc | e2cdcC6 | C:181-308 |
| O93715 | DB03461 | NAP | 2cdc | e2cdcD5 | D:1-187,D:309-366 |
| O93715 | DB03461 | NAP | 2cdc | e2cdcD6 | D:181-308 |