Attributes
UniProt ID
Protein Name
Cytochrome c isoform 1
Ligand Name
sulfonato-calix[8]arene
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KCEGJGDGMRAJEP-UHFFFAOYSA-N
SMILES
c1c(cc2c(c1Cc3cc(cc(c3O)Cc4cc(cc(c4O)Cc5cc(cc(c5O)Cc6cc(cc(c6O)Cc7cc(cc(c7O)Cc8cc(cc(c8O)Cc9cc(cc(c9O)C2)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O)O)S(=O)(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6GD6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6gd6A1
ECOD domains from experimental PDB structures interacting with ligand EVB
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00044 | n/a | EVB | 6gd6 | e6gd6A1 | A:-5-103 |
| P00044 | n/a | EVB | 6gd7 | e6gd7A1 | A:-5-103 |
| P00044 | n/a | EVB | 6gd8 | e6gd8A1 | A:-5-103 |
| P00044 | n/a | EVB | 6gd8 | e6gd8B1 | B:-5-103 |
| P00044 | n/a | EVB | 6gd8 | e6gd8C1 | C:-5-103 |
| P00044 | n/a | EVB | 6gd8 | e6gd8D1 | D:-5-103 |
| P00044 | n/a | EVB | 6gd9 | e6gd9A1 | A:-5-103 |
| P00044 | n/a | EVB | 6gda | e6gdaA1 | A:-5-103 |
| P00044 | n/a | EVB | 6rsi | e6rsiA1 | A:-5-103 |
| P00044 | n/a | EVB | 6rsj | e6rsjA1 | A:-5-103 |
| P00044 | n/a | EVB | 6rsk | e6rskA1 | A:-5-103 |
| P00044 | n/a | EVB | 6rsk | e6rskB1 | B:-5-103 |
| P00044 | n/a | EVB | 6rsl | e6rslA1 | A:-5-103 |
| P00044 | n/a | EVB | 6rsl | e6rslB1 | B:-5-103 |
| P00044 | n/a | EVB | 6y0j | e6y0jA1 | A:-3-103 |
| P00044 | n/a | EVB | 6y0j | e6y0jB1 | B:-3-103 |
| P00044 | n/a | EVB | 6y0j | e6y0jC1 | C:-2-103 |