Attributes
UniProt ID
Protein Name
Cytochrome b
Ligand Name
PROTOPORPHYRIN IX CONTAINING FE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KABFMIBPWCXCRK-RGGAHWMASA-L
SMILES
Cc1c2n3c(c1CCC(=O)O)C=C4C(=C(C5=[N]4[Fe]36[N]7=C(C=C8N6C(=C5)C(=C8C)C=C)C(=C(C7=C2)C)C=C)C)CCC(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1EZV
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1ezvA1e1ezvA2e1ezvB1e1ezvB2e1ezvC1e1ezvC2e1ezvD1e1ezvD2e1ezvE1e1ezvE2e1ezvE3e1ezvF1e1ezvG1e1ezvH1e1ezvI1e1ezvX1e1ezvY1
ECOD domains from experimental PDB structures interacting with ligand DB18267
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00163 | DB18267 | HEM | 1ezv | e1ezvC2 | C:14-261 |
| P00163 | DB18267 | HEM | 1kb9 | e1kb9C2 | C:14-261 |
| P00163 | DB18267 | HEM | 3cx5 | e3cx5C2 | C:14-261 |
| P00163 | DB18267 | HEM | 3cx5 | e3cx5N1 | N:262-380 |
| P00163 | DB18267 | HEM | 3cx5 | e3cx5N2 | N:14-261 |
| P00163 | DB18267 | HEM | 3cxh | e3cxhC1 | C:262-380 |
| P00163 | DB18267 | HEM | 3cxh | e3cxhC2 | C:14-261 |
| P00163 | DB18267 | HEM | 3cxh | e3cxhN2 | N:14-261 |
| P00163 | DB18267 | HEM | 4pd4 | e4pd4C2 | C:1-261 |
| P00163 | DB18267 | HEM | 6hu9 | e6hu9C2 | C:1-261 |
| P00163 | DB18267 | HEM | 6hu9 | e6hu9N1 | N:1-261 |
| P00163 | DB18267 | HEM | 6t0b | e6t0bC2 | C:1-261 |
| P00163 | DB18267 | HEM | 6t0b | e6t0bN1 | N:1-261 |
| P00163 | DB18267 | HEM | 6t15 | e6t15C2 | C:1-261 |
| P00163 | DB18267 | HEM | 6t15 | e6t15N1 | N:1-261 |
| P00163 | DB18267 | HEM | 6t15 | e6t15N2 | N:262-385 |
| P00163 | DB18267 | HEM | 6ymx | e6ymxC1 | C:1-261 |
| P00163 | DB18267 | HEM | 6ymx | e6ymxN1 | N:1-261 |
| P00163 | DB18267 | HEM | 6ymx | e6ymxN2 | N:262-385 |
| P00163 | DB18267 | HEM | 8e7s | e8e7sJ2 | J:1-261 |
| P00163 | DB18267 | HEM | 8e7s | e8e7sj1 | j:1-261 |
| P00163 | DB18267 | HEM | 8ec0 | e8ec0J2 | J:1-261 |
| P00163 | DB18267 | HEM | 8ec0 | e8ec0j1 | j:262-385 |
| P00163 | DB18267 | HEM | 8ec0 | e8ec0j2 | j:1-261 |