Attributes
UniProt ID
Protein Name
L-lactate dehydrogenase
Ligand Name
FLAVIN MONONUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FVTCRASFADXXNN-SCRDCRAPSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1FCB
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1fcbA1e1fcbA2e1fcbB1
ECOD domains from experimental PDB structures interacting with ligand DB03247
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00175 | DB03247 | FMN | 1fcb | e1fcbA2 | A:98-511 |
| P00175 | DB03247 | FMN | 1fcb | e1fcbB1 | B:100-511 |
| P00175 | DB03247 | FMN | 1kbi | e1kbiA2 | A:98-511 |
| P00175 | DB03247 | FMN | 1kbi | e1kbiB1 | B:99-511 |
| P00175 | DB03247 | FMN | 1kbj | e1kbjA1 | A:100-511 |
| P00175 | DB03247 | FMN | 1kbj | e1kbjB1 | B:100-511 |
| P00175 | DB03247 | FMN | 1lco | e1lcoA2 | A:98-511 |
| P00175 | DB03247 | FMN | 1lco | e1lcoB1 | B:102-511 |
| P00175 | DB03247 | FMN | 1ldc | e1ldcA2 | A:98-296,A:321-511 |
| P00175 | DB03247 | FMN | 1ldc | e1ldcB1 | B:102-296,B:325-511 |
| P00175 | DB03247 | FMN | 1ltd | e1ltdA2 | A:98-511 |
| P00175 | DB03247 | FMN | 1ltd | e1ltdB1 | B:102-511 |
| P00175 | DB03247 | FMN | 1sze | e1szeA1 | A:100-511 |
| P00175 | DB03247 | FMN | 1sze | e1szeB1 | B:100-511 |
| P00175 | DB03247 | FMN | 1szf | e1szfA1 | A:100-511 |
| P00175 | DB03247 | FMN | 1szf | e1szfB1 | B:100-511 |
| P00175 | DB03247 | FMN | 2oz0 | e2oz0A2 | A:98-510 |
| P00175 | DB03247 | FMN | 2oz0 | e2oz0B1 | B:98-510 |