Attributes
UniProt ID
Protein Name
Cytochrome P450 2B4
Ligand Name
5-CYCLOHEXYL-1-PENTYL-BETA-D-MALTOSIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RVTGFZGNOSKUDA-ZNGNCRBCSA-N
SMILES
C1CCC(CC1)CCCCCOC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2BDM
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2bdmA1
ECOD domains from experimental PDB structures interacting with ligand DB04664
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00178 | DB04664 | CM5 | 2bdm | e2bdmA1 | A:28-492 |
| P00178 | DB04664 | CM5 | 3g5n | e3g5nA1 | A:27-493 |
| P00178 | DB04664 | CM5 | 3g5n | e3g5nB1 | B:28-492 |
| P00178 | DB04664 | CM5 | 3g5n | e3g5nC1 | C:26-492 |
| P00178 | DB04664 | CM5 | 3g5n | e3g5nD1 | D:28-492 |
| P00178 | DB04664 | CM5 | 3kw4 | e3kw4A1 | A:27-492 |
| P00178 | DB04664 | CM5 | 3mvr | e3mvrA1 | A:28-492 |
| P00178 | DB04664 | CM5 | 3mvr | e3mvrB1 | B:28-492 |
| P00178 | DB04664 | CM5 | 3r1b | e3r1bA1 | A:28-492 |
| P00178 | DB04664 | CM5 | 3r1b | e3r1bB1 | B:28-492 |
| P00178 | DB04664 | CM5 | 3r1b | e3r1bD1 | D:28-491 |
| P00178 | DB04664 | CM5 | 3tmz | e3tmzA1 | A:20-492 |
| P00178 | DB04664 | CM5 | 3uas | e3uasA1 | A:28-492 |
| P00178 | DB04664 | CM5 | 4h1n | e4h1nA1 | A:29-492 |
| P00178 | DB04664 | CM5 | 4jlt | e4jltA1 | A:28-492 |
| P00178 | DB04664 | CM5 | 5em4 | e5em4A1 | A:29-492 |
| P00178 | DB04664 | CM5 | 5em4 | e5em4B1 | B:29-492 |
| P00178 | DB04664 | CM5 | 5iuz | e5iuzA1 | A:29-492 |
| P00178 | DB04664 | CM5 | 5iuz | e5iuzB1 | B:29-492 |
| P00178 | DB04664 | CM5 | 6bww | e6bwwA1 | A:28-491 |