Attributes
UniProt ID
Protein Name
L-lactate dehydrogenase A chain
Ligand Name
~{N}-[3-[(7-nitrodibenzofuran-2-yl)sulfonylamino]phenyl]-1-oxidanyl-cyclopropane-1-carboxamide
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FIPNFNFASWRACL-UHFFFAOYSA-N
SMILES
c1cc(cc(c1)NS(=O)(=O)c2ccc3c(c2)c4ccc(cc4o3)[N+](=O)[O-])NC(=O)C5(CC5)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6SBV
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6sbvA1e6sbvA2e6sbvB1e6sbvB2e6sbvC1e6sbvC2e6sbvD1e6sbvD2e6sbvE1e6sbvE2e6sbvF1e6sbvF2e6sbvG1e6sbvG2e6sbvH1e6sbvH2
ECOD domains from experimental PDB structures interacting with ligand L5K
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00338 | n/a | L5K | 6sbv | e6sbvA1 | A:2-160 |
| P00338 | n/a | L5K | 6sbv | e6sbvA2 | A:161-332 |
| P00338 | n/a | L5K | 6sbv | e6sbvB1 | B:2-160 |
| P00338 | n/a | L5K | 6sbv | e6sbvB2 | B:161-332 |
| P00338 | n/a | L5K | 6sbv | e6sbvC1 | C:161-332 |
| P00338 | n/a | L5K | 6sbv | e6sbvC2 | C:2-160 |
| P00338 | n/a | L5K | 6sbv | e6sbvD1 | D:2-160 |
| P00338 | n/a | L5K | 6sbv | e6sbvD2 | D:161-332 |
| P00338 | n/a | L5K | 6sbv | e6sbvE1 | E:2-160 |
| P00338 | n/a | L5K | 6sbv | e6sbvE2 | E:161-332 |
| P00338 | n/a | L5K | 6sbv | e6sbvF1 | F:161-332 |
| P00338 | n/a | L5K | 6sbv | e6sbvF2 | F:2-160 |
| P00338 | n/a | L5K | 6sbv | e6sbvG1 | G:161-332 |
| P00338 | n/a | L5K | 6sbv | e6sbvG2 | G:2-160 |
| P00338 | n/a | L5K | 6sbv | e6sbvH1 | H:2-160 |
| P00338 | n/a | L5K | 6sbv | e6sbvH2 | H:161-332 |