Attributes
UniProt ID
Protein Name
L-lactate dehydrogenase
Ligand Name
1,6-di-O-phosphono-beta-D-fructofuranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RNBGYGVWRKECFJ-ARQDHWQXSA-N
SMILES
C(C1C(C(C(O1)(COP(=O)(O)O)O)O)O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1LDN
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1ldnA2e1ldnA3e1ldnB2e1ldnB3e1ldnC2e1ldnC3e1ldnD2e1ldnD3e1ldnE2e1ldnE3e1ldnF2e1ldnF3e1ldnG2e1ldnG3e1ldnH2e1ldnH3
ECOD domains from experimental PDB structures interacting with ligand DB04551
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00344 | DB04551 | FBP | 1ldn | e1ldnA2 | A:15-162 |
| P00344 | DB04551 | FBP | 1ldn | e1ldnA3 | A:163-330 |
| P00344 | DB04551 | FBP | 1ldn | e1ldnB3 | B:163-330 |
| P00344 | DB04551 | FBP | 1ldn | e1ldnC3 | C:163-330 |
| P00344 | DB04551 | FBP | 1ldn | e1ldnD2 | D:15-162 |
| P00344 | DB04551 | FBP | 1ldn | e1ldnD3 | D:163-330 |
| P00344 | DB04551 | FBP | 1ldn | e1ldnE3 | E:163-330 |
| P00344 | DB04551 | FBP | 1ldn | e1ldnF3 | F:163-330 |
| P00344 | DB04551 | FBP | 1ldn | e1ldnG3 | G:163-330 |
| P00344 | DB04551 | FBP | 1ldn | e1ldnH2 | H:15-162 |
| P00344 | DB04551 | FBP | 1ldn | e1ldnH3 | H:163-330 |
| P00344 | DB04551 | FBP | 2ldb | e2ldbA2 | A:15-162 |
| P00344 | DB04551 | FBP | 2ldb | e2ldbA3 | A:163-331 |
| P00344 | DB04551 | FBP | 2ldb | e2ldbB2 | B:15-162 |
| P00344 | DB04551 | FBP | 2ldb | e2ldbB3 | B:163-331 |
| P00344 | DB04551 | FBP | 2ldb | e2ldbC3 | C:163-331 |
| P00344 | DB04551 | FBP | 2ldb | e2ldbD3 | D:163-331 |