Attributes
UniProt ID
Protein Name
Glutamate dehydrogenase 1, mitochondrial
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1NQT
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1nqtA1e1nqtA2e1nqtB1e1nqtB2e1nqtC1e1nqtC2e1nqtD1e1nqtD2e1nqtE1e1nqtE2e1nqtF1e1nqtF2e1nqtG1e1nqtG2e1nqtH1e1nqtH2e1nqtI1e1nqtI2e1nqtJ1e1nqtJ2e1nqtK1e1nqtK2e1nqtL1e1nqtL2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00366 | DB16833 | ADP | 1nqt | e1nqtA1 | A:209-501 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtA2 | A:6-208 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtB1 | B:209-501 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtB2 | B:6-208 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtC1 | C:209-501 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtC2 | C:6-208 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtD1 | D:209-501 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtD2 | D:6-208 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtE1 | E:209-501 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtE2 | E:6-208 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtF1 | F:209-501 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtF2 | F:6-208 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtG1 | G:209-501 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtG2 | G:6-208 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtH1 | H:209-501 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtH2 | H:6-208 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtI1 | I:209-501 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtI2 | I:6-208 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtJ1 | J:209-501 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtJ2 | J:6-208 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtK1 | K:209-501 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtK2 | K:6-208 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtL1 | L:209-501 |
| P00366 | DB16833 | ADP | 1nqt | e1nqtL2 | L:6-208 |