Attributes
UniProt ID
Protein Name
NADH-cytochrome b5 reductase 3
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1UMK
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1umkA1e1umkA2
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00387 | DB03147 | FAD | 1umk | e1umkA1 | A:30-153 |
| P00387 | DB03147 | FAD | 1umk | e1umkA2 | A:154-300 |
| P00387 | DB03147 | FAD | 7thg | e7thgA1 | A:154-300 |
| P00387 | DB03147 | FAD | 7thg | e7thgA2 | A:31-153 |
| P00387 | DB03147 | FAD | 7tnv | e7tnvA1 | A:32-154 |
| P00387 | DB03147 | FAD | 7tnv | e7tnvA2 | A:155-301 |
| P00387 | DB03147 | FAD | 7tsw | e7tswA1 | A:31-154 |
| P00387 | DB03147 | FAD | 7tsw | e7tswA2 | A:155-301 |
| P00387 | DB03147 | FAD | 7tsw | e7tswB1 | B:31-154 |
| P00387 | DB03147 | FAD | 7tsw | e7tswB2 | B:155-301 |
| P00387 | DB03147 | FAD | 7tsw | e7tswC1 | C:31-154 |
| P00387 | DB03147 | FAD | 7tsw | e7tswC2 | C:155-301 |
| P00387 | DB03147 | FAD | 7tsw | e7tswD1 | D:155-301 |
| P00387 | DB03147 | FAD | 7tsw | e7tswD2 | D:32-154 |
| P00387 | DB03147 | FAD | 7tsw | e7tswE1 | E:31-154 |
| P00387 | DB03147 | FAD | 7tsw | e7tswE2 | E:155-301 |
| P00387 | DB03147 | FAD | 7tsw | e7tswF1 | F:31-154 |
| P00387 | DB03147 | FAD | 7tsw | e7tswF2 | F:155-301 |
| P00387 | DB03147 | FAD | 7w3o | e7w3oA1 | A:4-128 |
| P00387 | DB03147 | FAD | 7w3o | e7w3oA2 | A:129-275 |
| P00387 | DB03147 | FAD | 7w3o | e7w3oB1 | B:129-275 |
| P00387 | DB03147 | FAD | 7w3o | e7w3oB2 | B:4-128 |
| P00387 | DB03147 | FAD | 7w3o | e7w3oC1 | C:4-128 |
| P00387 | DB03147 | FAD | 7w3o | e7w3oC2 | C:129-275 |
| P00387 | DB03147 | FAD | 7w3o | e7w3oD1 | D:6-128 |
| P00387 | DB03147 | FAD | 7w3o | e7w3oD2 | D:129-275 |