Attributes
UniProt ID
Protein Name
Cytochrome c oxidase subunit 7C, mitochondrial
Ligand Name
CHOLIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BHQCQFFYRZLCQQ-OELDTZBJSA-N
SMILES
CC(CCC(=O)O)C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3AG2
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3ag2A1e3ag2B1e3ag2B2e3ag2C1e3ag2D1e3ag2E1e3ag2F1e3ag2G1e3ag2H1e3ag2I1e3ag2J1e3ag2K1e3ag2L1e3ag2M1e3ag2N1e3ag2O1e3ag2O2e3ag2P1e3ag2Q1e3ag2R1e3ag2S1e3ag2T1e3ag2U1e3ag2V1e3ag2W1e3ag2X1e3ag2Y1e3ag2Z1
ECOD domains from experimental PDB structures interacting with ligand DB02659
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00430 | DB02659 | CHD | 3ag2 | e3ag2Y1 | Y:2-47 |
| P00430 | DB02659 | CHD | 5b3s | e5b3sY1 | Y:2-47 |
| P00430 | DB02659 | CHD | 6juw | e6juwL1 | L:2-47 |
| P00430 | DB02659 | CHD | 6juw | e6juwY1 | Y:2-47 |
| P00430 | DB02659 | CHD | 7cp5 | e7cp5L1 | L:2-47 |
| P00430 | DB02659 | CHD | 7cp5 | e7cp5Y1 | Y:2-47 |
| P00430 | DB02659 | CHD | 7d5w | e7d5wL1 | L:2-47 |
| P00430 | DB02659 | CHD | 7d5w | e7d5wY1 | Y:2-47 |
| P00430 | DB02659 | CHD | 7d5x | e7d5xL1 | L:2-47 |
| P00430 | DB02659 | CHD | 7ev7 | e7ev7Y1 | Y:2-47 |
| P00430 | DB02659 | CHD | 7vuw | e7vuwY1 | Y:2-47 |
| P00430 | DB02659 | CHD | 7vvr | e7vvrL1 | L:2-47 |
| P00430 | DB02659 | CHD | 7vvr | e7vvrY1 | Y:2-47 |
| P00430 | DB02659 | CHD | 7y44 | e7y44L1 | L:2-47 |
| P00430 | DB02659 | CHD | 7y44 | e7y44Y1 | Y:2-47 |
| P00430 | DB02659 | CHD | 7ypy | e7ypyL1 | L:2-47 |
| P00430 | DB02659 | CHD | 7ypy | e7ypyY1 | Y:2-47 |
| P00430 | DB02659 | CHD | 8gcq | e8gcqY1 | Y:2-47 |