Attributes
UniProt ID
Protein Name
Ribonucleoside-diphosphate reductase 1 subunit alpha
Ligand Name
2'-DEOXYADENOSINE-5'-DIPHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
DAEAPNUQQAICNR-RRKCRQDMSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3CC(C(O3)COP(=O)(O)OP(=O)(O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4ERM
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4ermA2e4ermA3e4ermA4e4ermB2e4ermB3e4ermB4e4ermC2e4ermC3e4ermC4e4ermD1e4ermD2e4ermD3e4ermE1e4ermF1e4ermG1e4ermH1
ECOD domains from experimental PDB structures interacting with ligand DAT
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00452 | n/a | DAT | 4erm | e4ermA2 | A:218-736 |
| P00452 | n/a | DAT | 4erm | e4ermA4 | A:100-221 |
| P00452 | n/a | DAT | 4erm | e4ermB2 | B:215-733 |
| P00452 | n/a | DAT | 4erm | e4ermB4 | B:100-221 |
| P00452 | n/a | DAT | 4erm | e4ermC2 | C:215-733 |
| P00452 | n/a | DAT | 4erm | e4ermC3 | C:100-221 |
| P00452 | n/a | DAT | 4erm | e4ermD2 | D:215-733 |
| P00452 | n/a | DAT | 4erm | e4ermD3 | D:100-221 |
| P00452 | n/a | DAT | 5cns | e5cnsA2 | A:5-99 |
| P00452 | n/a | DAT | 5cns | e5cnsB3 | B:4-99 |
| P00452 | n/a | DAT | 5cns | e5cnsC3 | C:5-99 |
| P00452 | n/a | DAT | 5cns | e5cnsD4 | D:4-99 |
| P00452 | n/a | DAT | 5cnu | e5cnuA3 | A:5-99 |
| P00452 | n/a | DAT | 5cnu | e5cnuB1 | B:4-99 |
| P00452 | n/a | DAT | 5cnu | e5cnuC2 | C:4-99 |
| P00452 | n/a | DAT | 5cnu | e5cnuD2 | D:4-99 |
| P00452 | n/a | DAT | 5cnv | e5cnvA2 | A:1-99 |
| P00452 | n/a | DAT | 5cnv | e5cnvB2 | B:5-99 |
| P00452 | n/a | DAT | 5cnv | e5cnvC3 | C:4-99 |
| P00452 | n/a | DAT | 5cnv | e5cnvD2 | D:4-99 |