Attributes
UniProt ID
Protein Name
Ribonucleoside-diphosphate reductase 1 subunit alpha
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4R1R
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4r1rA1e4r1rA2e4r1rA3e4r1rB1e4r1rB2e4r1rB3e4r1rC1e4r1rC2e4r1rC3
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00452 | DB04315 | GDP | 4r1r | e4r1rA1 | A:100-221 |
| P00452 | DB04315 | GDP | 4r1r | e4r1rA2 | A:222-737 |
| P00452 | DB04315 | GDP | 4r1r | e4r1rB1 | B:100-221 |
| P00452 | DB04315 | GDP | 4r1r | e4r1rB2 | B:222-737 |
| P00452 | DB04315 | GDP | 4r1r | e4r1rC1 | C:100-221 |
| P00452 | DB04315 | GDP | 4r1r | e4r1rC2 | C:222-737 |
| P00452 | DB04315 | GDP | 5cnv | e5cnvA1 | A:222-736 |
| P00452 | DB04315 | GDP | 5cnv | e5cnvA3 | A:100-221 |
| P00452 | DB04315 | GDP | 5cnv | e5cnvB1 | B:215-736 |
| P00452 | DB04315 | GDP | 5cnv | e5cnvB3 | B:100-221 |
| P00452 | DB04315 | GDP | 5cnv | e5cnvC1 | C:222-737 |
| P00452 | DB04315 | GDP | 5cnv | e5cnvC2 | C:100-221 |
| P00452 | DB04315 | GDP | 5cnv | e5cnvD1 | D:222-737 |
| P00452 | DB04315 | GDP | 5cnv | e5cnvD3 | D:100-221 |
| P00452 | DB04315 | GDP | 6w4x | e6w4xB1 | B:100-221 |
| P00452 | DB04315 | GDP | 6w4x | e6w4xB3 | B:215-742 |