Attributes
UniProt ID
Protein Name
Glycogen phosphorylase, muscle form
Ligand Name
ADENOSINE MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
UDMBCSSLTHHNCD-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1PYG
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1pygA1e1pygA2e1pygB1e1pygB2e1pygC1e1pygC2e1pygD1e1pygD2
ECOD domains from experimental PDB structures interacting with ligand DB00131
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00489 | DB00131 | AMP | 1pyg | e1pygA1 | A:10-484 |
| P00489 | DB00131 | AMP | 1pyg | e1pygB1 | B:20-484 |
| P00489 | DB00131 | AMP | 1pyg | e1pygC1 | C:10-484 |
| P00489 | DB00131 | AMP | 1pyg | e1pygD2 | D:10-484 |
| P00489 | DB00131 | AMP | 3e3n | e3e3nA1 | A:7-484 |
| P00489 | DB00131 | AMP | 3e3n | e3e3nB1 | B:7-484 |
| P00489 | DB00131 | AMP | 3e3n | e3e3nC2 | C:9-484 |
| P00489 | DB00131 | AMP | 3e3n | e3e3nD1 | D:7-484 |
| P00489 | DB00131 | AMP | 3e3n | e3e3nE1 | E:8-484 |
| P00489 | DB00131 | AMP | 3e3n | e3e3nF1 | F:8-484 |
| P00489 | DB00131 | AMP | 3e3n | e3e3nG1 | G:7-484 |
| P00489 | DB00131 | AMP | 3e3n | e3e3nH1 | H:6-484 |
| P00489 | DB00131 | AMP | 6gpb | e6gpbA1 | A:14-484 |
| P00489 | DB00131 | AMP | 7gpb | e7gpbA1 | A:10-484 |
| P00489 | DB00131 | AMP | 7gpb | e7gpbB1 | B:10-484 |
| P00489 | DB00131 | AMP | 7gpb | e7gpbC2 | C:10-484 |
| P00489 | DB00131 | AMP | 7gpb | e7gpbD2 | D:10-484 |
| P00489 | DB00131 | AMP | 8gpb | e8gpbA1 | A:485-842 |
| P00489 | DB00131 | AMP | 8gpb | e8gpbA2 | A:11-484 |