Attributes
UniProt ID
Protein Name
Purine nucleoside phosphorylase
Ligand Name
2-amino-7-{[(3R,4R)-3-hydroxy-4-(hydroxymethyl)pyrrolidin-1-yl]methyl}-3,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
GSPTUGDLYPMLCQ-SFYZADRCSA-N
SMILES
c1c(c2c([nH]1)C(=O)NC(=N2)N)CN3CC(C(C3)O)CO
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3PHB
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3phbE1e3phbQ1e3phbS1e3phbT1e3phbU1e3phbY1
ECOD domains from experimental PDB structures interacting with ligand IM5
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00491 | n/a | IM5 | 3phb | e3phbE1 | E:-2-285 |
| P00491 | n/a | IM5 | 3phb | e3phbQ1 | Q:-1-285 |
| P00491 | n/a | IM5 | 3phb | e3phbS1 | S:0-285 |
| P00491 | n/a | IM5 | 3phb | e3phbT1 | T:-2-284 |
| P00491 | n/a | IM5 | 3phb | e3phbU1 | U:3-287 |
| P00491 | n/a | IM5 | 3phb | e3phbY1 | Y:1-285 |
| P00491 | n/a | IM5 | 4ear | e4earA1 | A:4-286 |
| P00491 | n/a | IM5 | 4ear | e4earB1 | B:2-288 |
| P00491 | n/a | IM5 | 4ear | e4earC1 | C:4-288 |
| P00491 | n/a | IM5 | 4eb8 | e4eb8A1 | A:-1-286 |
| P00491 | n/a | IM5 | 4eb8 | e4eb8B1 | B:-1-286 |
| P00491 | n/a | IM5 | 4eb8 | e4eb8C1 | C:4-286 |
| P00491 | n/a | IM5 | 5etj | e5etjA1 | A:-1-286 |
| P00491 | n/a | IM5 | 5etj | e5etjB1 | B:0-286 |
| P00491 | n/a | IM5 | 5etj | e5etjC1 | C:-1-286 |
| P00491 | n/a | IM5 | 5etj | e5etjD1 | D:-1-286 |
| P00491 | n/a | IM5 | 5etj | e5etjE1 | E:-1-286 |
| P00491 | n/a | IM5 | 5etj | e5etjF1 | F:-1-286 |
| P00491 | n/a | IM5 | 5ugf | e5ugfA1 | A:1-286 |
| P00491 | n/a | IM5 | 5ugf | e5ugfB1 | B:0-286 |
| P00491 | n/a | IM5 | 5ugf | e5ugfC1 | C:-1-286 |
| P00491 | n/a | IM5 | 5ugf | e5ugfD1 | D:1-286 |
| P00491 | n/a | IM5 | 5ugf | e5ugfE1 | E:0-286 |
| P00491 | n/a | IM5 | 5ugf | e5ugfF1 | F:0-286 |