Attributes
UniProt ID
Protein Name
Aspartate aminotransferase
Ligand Name
4'-DEOXY-4'-AMINOPYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZMJGSOSNSPKHNH-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)CN)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1AIA
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1aiaA2e1aiaA3e1aiaB2e1aiaB3
ECOD domains from experimental PDB structures interacting with ligand DB02142
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00509 | DB02142 | PMP | 1aia | e1aiaA3 | A:5-308 |
| P00509 | DB02142 | PMP | 1aia | e1aiaB3 | B:5-308 |
| P00509 | DB02142 | PMP | 1aib | e1aibA3 | A:5-308 |
| P00509 | DB02142 | PMP | 1aib | e1aibB3 | B:5-308 |
| P00509 | DB02142 | PMP | 1aic | e1aicA3 | A:5-308 |
| P00509 | DB02142 | PMP | 1aic | e1aicB3 | B:5-308 |
| P00509 | DB02142 | PMP | 1amq | e1amqA3 | A:5-308 |
| P00509 | DB02142 | PMP | 1amr | e1amrA3 | A:5-308 |
| P00509 | DB02142 | PMP | 1ams | e1amsA3 | A:5-308 |
| P00509 | DB02142 | PMP | 2aat | e2aatA3 | A:13-308 |
| P00509 | DB02142 | PMP | 2q7w | e2q7wA2 | A:1-313 |
| P00509 | DB02142 | PMP | 2qa3 | e2qa3A3 | A:1-296 |
| P00509 | DB02142 | PMP | 2qb2 | e2qb2A3 | A:1-296 |
| P00509 | DB02142 | PMP | 2qb3 | e2qb3A3 | A:1-296 |
| P00509 | DB02142 | PMP | 2qbt | e2qbtA3 | A:1-296 |
| P00509 | DB02142 | PMP | 3zzk | e3zzkA2 | A:297-396 |
| P00509 | DB02142 | PMP | 3zzk | e3zzkA3 | A:1-296 |
| P00509 | DB02142 | PMP | 5vwq | e5vwqA1 | A:1-296 |
| P00509 | DB02142 | PMP | 5vwq | e5vwqD1 | D:1-296 |
| P00509 | DB02142 | PMP | 5vwq | e5vwqG2 | G:1-296 |
| P00509 | DB02142 | PMP | 5vwq | e5vwqJ2 | J:1-296 |