Attributes
UniProt ID
Protein Name
ATP-dependent 6-phosphofructokinase
Ligand Name
6-O-phosphono-beta-D-fructofuranose
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BGWGXPAPYGQALX-ARQDHWQXSA-N
SMILES
C(C1C(C(C(O1)(CO)O)O)O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1MTO
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1mtoA1e1mtoA2e1mtoB1e1mtoB2e1mtoC1e1mtoC2e1mtoD1e1mtoD2e1mtoE1e1mtoE2e1mtoF1e1mtoF2e1mtoG1e1mtoG2e1mtoH1e1mtoH2
ECOD domains from experimental PDB structures interacting with ligand F6P
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00512 | n/a | F6P | 1mto | e1mtoA1 | A:138-256 |
| P00512 | n/a | F6P | 1mto | e1mtoA2 | A:1-137,A:257-319 |
| P00512 | n/a | F6P | 1mto | e1mtoB1 | B:138-256 |
| P00512 | n/a | F6P | 1mto | e1mtoB2 | B:1-137,B:257-319 |
| P00512 | n/a | F6P | 1mto | e1mtoC1 | C:138-256 |
| P00512 | n/a | F6P | 1mto | e1mtoC2 | C:1-137,C:257-319 |
| P00512 | n/a | F6P | 1mto | e1mtoD1 | D:1-137,D:257-319 |
| P00512 | n/a | F6P | 1mto | e1mtoD2 | D:138-256 |
| P00512 | n/a | F6P | 1mto | e1mtoE1 | E:1-137,E:257-319 |
| P00512 | n/a | F6P | 1mto | e1mtoE2 | E:138-256 |
| P00512 | n/a | F6P | 1mto | e1mtoF1 | F:1-137,F:257-319 |
| P00512 | n/a | F6P | 1mto | e1mtoF2 | F:138-256 |
| P00512 | n/a | F6P | 1mto | e1mtoG1 | G:138-256 |
| P00512 | n/a | F6P | 1mto | e1mtoG2 | G:1-137,G:257-319 |
| P00512 | n/a | F6P | 1mto | e1mtoH1 | H:1-137,H:257-319 |
| P00512 | n/a | F6P | 1mto | e1mtoH2 | H:138-256 |
| P00512 | n/a | F6P | 4pfk | e4pfkA1 | A:138-256 |
| P00512 | n/a | F6P | 4pfk | e4pfkA2 | A:1-137,A:257-320 |