Attributes
UniProt ID
Protein Name
Epidermal growth factor receptor
Ligand Name
N-(2-{[2-(dimethylamino)ethyl](methyl)amino}-4-methoxy-5-{[4-(1-methyl-1H-indol-3-yl)pyrimidin-2-yl]amino}phenyl)prop-2-enamide
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
DUYJMQONPNNFPI-UHFFFAOYSA-N
SMILES
Cn1cc(c2c1cccc2)c3ccnc(n3)Nc4cc(c(cc4OC)N(C)CCN(C)C)NC(=O)C=C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4ZAU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4zauA1
ECOD domains from experimental PDB structures interacting with ligand DB09330
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00533 | DB09330 | YY3 | 4zau | e4zauA1 | A:698-984,A:1008-1017 |
| P00533 | DB09330 | YY3 | 6jwl | e6jwlA1 | A:696-1020 |
| P00533 | DB09330 | YY3 | 6jx4 | e6jx4A1 | A:696-1018 |
| P00533 | DB09330 | YY3 | 6jxt | e6jxtA1 | A:697-984 |
| P00533 | DB09330 | YY3 | 6lud | e6ludA1 | A:696-1018 |
| P00533 | DB09330 | YY3 | 7jxm | e7jxmB1 | B:701-1012 |
| P00533 | DB09330 | YY3 | 7jxp | e7jxpC1 | C:700-986 |
| P00533 | DB09330 | YY3 | 7jxp | e7jxpE1 | E:700-986 |
| P00533 | DB09330 | YY3 | 7jxw | e7jxwA1 | A:700-986 |
| P00533 | DB09330 | YY3 | 7jxw | e7jxwB1 | B:700-986 |
| P00533 | DB09330 | YY3 | 7jxw | e7jxwC1 | C:700-986 |
| P00533 | DB09330 | YY3 | 7jxw | e7jxwD1 | D:700-986 |
| P00533 | DB09330 | YY3 | 7k1h | e7k1hA1 | A:701-985 |
| P00533 | DB09330 | YY3 | 7k1h | e7k1hB1 | B:701-986 |
| P00533 | DB09330 | YY3 | 7k1h | e7k1hC1 | C:701-985 |
| P00533 | DB09330 | YY3 | 7k1h | e7k1hD1 | D:701-985 |
| P00533 | DB09330 | YY3 | 7k1h | e7k1hE1 | E:703-985 |
| P00533 | DB09330 | YY3 | 7k1h | e7k1hF1 | F:701-985 |