Attributes
UniProt ID
Protein Name
Lysozyme C
Ligand Name
4-(2-HYDROXYETHYL)-1-PIPERAZINE ETHANESULFONIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
JKMHFZQWWAIEOD-UHFFFAOYSA-N
SMILES
C1CN(CCN1CCO)CCS(=O)(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2HUB
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2hubA1
ECOD domains from experimental PDB structures interacting with ligand DB16872
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00698 | DB16872 | EPE | 2hub | e2hubA1 | A:1-129 |
| P00698 | DB16872 | EPE | 3e3d | e3e3dA1 | A:1-129 |
| P00698 | DB16872 | EPE | 3rz4 | e3rz4A1 | A:1-129 |
| P00698 | DB16872 | EPE | 4glv | e4glvC1 | C:1-129 |
| P00698 | DB16872 | EPE | 4gn3 | e4gn3A1 | A:1-129 |
| P00698 | DB16872 | EPE | 4gn3 | e4gn3G1 | G:1-129 |
| P00698 | DB16872 | EPE | 4gn3 | e4gn3I1 | I:1-129 |
| P00698 | DB16872 | EPE | 4gn3 | e4gn3K1 | K:1-129 |
| P00698 | DB16872 | EPE | 4gn5 | e4gn5C1 | C:1-129 |
| P00698 | DB16872 | EPE | 4gn5 | e4gn5D1 | D:1-129 |
| P00698 | DB16872 | EPE | 7ol5 | e7ol5A1 | A:1-128 |
| P00698 | DB16872 | EPE | 7qq1 | e7qq1A1 | A:1-129 |
| P00698 | DB16872 | EPE | 7z6j | e7z6jA1 | A:1-129 |
| P00698 | DB16872 | EPE | 7zu6 | e7zu6AAA1 | AAA:1-129 |
| P00698 | DB16872 | EPE | 8aj3 | e8aj3A1 | A:1-129 |
| P00698 | DB16872 | EPE | 8aj4 | e8aj4AAA1 | AAA:1-129 |
| P00698 | DB16872 | EPE | 8bov | e8bovAAA1 | AAA:1-129 |
| P00698 | DB16872 | EPE | 8bpu | e8bpuAAA1 | AAA:1-129 |
| P00698 | DB16872 | EPE | 8omt | e8omtAAA1 | AAA:1-129 |
| P00698 | DB16872 | EPE | 8pfx | e8pfxA1 | A:1-129 |
| P00698 | DB16872 | EPE | 8pfy | e8pfyA1 | A:1-129 |
| P00698 | DB16872 | EPE | 8ph5 | e8ph5AAA1 | AAA:1-129 |
| P00698 | DB16872 | EPE | 8ph6 | e8ph6A1 | A:1-129 |