Attributes
UniProt ID
Protein Name
L-asparaginase 2
Ligand Name
CITRIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KRKNYBCHXYNGOX-UHFFFAOYSA-N
SMILES
C(C(=O)O)C(CC(=O)O)(C(=O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6NX6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6nx6A1e6nx6A2e6nx6B1e6nx6B2
ECOD domains from experimental PDB structures interacting with ligand DB04272
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00805 | DB04272 | CIT | 6nx6 | e6nx6B2 | B:0-209 |
| P00805 | DB04272 | CIT | 6nx7 | e6nx7B2 | B:0-209 |
| P00805 | DB04272 | CIT | 6nx8 | e6nx8B2 | B:1-209 |
| P00805 | DB04272 | CIT | 6nxb | e6nxbA1 | A:210-326 |
| P00805 | DB04272 | CIT | 6nxb | e6nxbA2 | A:-3-209 |
| P00805 | DB04272 | CIT | 6nxb | e6nxbB1 | B:210-326 |
| P00805 | DB04272 | CIT | 6nxb | e6nxbB2 | B:-3-209 |
| P00805 | DB04272 | CIT | 6nxb | e6nxbC1 | C:210-326 |
| P00805 | DB04272 | CIT | 6nxb | e6nxbD1 | D:210-326 |
| P00805 | DB04272 | CIT | 6nxb | e6nxbD2 | D:-3-209 |
| P00805 | DB04272 | CIT | 6pab | e6pabA2 | A:210-326 |
| P00805 | DB04272 | CIT | 6pab | e6pabB1 | B:210-326 |
| P00805 | DB04272 | CIT | 6pab | e6pabC2 | C:210-326 |
| P00805 | DB04272 | CIT | 6pab | e6pabD2 | D:210-326 |
| P00805 | DB04272 | CIT | 6v2b | e6v2bA1 | A:210-326 |
| P00805 | DB04272 | CIT | 6v2b | e6v2bB2 | B:210-326 |
| P00805 | DB04272 | CIT | 6v2b | e6v2bC2 | C:210-326 |
| P00805 | DB04272 | CIT | 6v2b | e6v2bD2 | D:210-326 |
| P00805 | DB04272 | CIT | 8ecd | e8ecdC2 | C:210-326 |
| P00805 | DB04272 | CIT | 8ecd | e8ecdD2 | D:210-326 |