Attributes
UniProt ID
Protein Name
Ribulose bisphosphate carboxylase large chain
Ligand Name
2-CARBOXYARABINITOL-1,5-DIPHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ITHCSGCUQDMYAI-ZMIZWQJLSA-N
SMILES
C(C(C(C(COP(=O)(O)O)(C(=O)O)O)O)O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1RBL
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1rblA1e1rblA2e1rblB1e1rblB2e1rblC1e1rblC2e1rblD1e1rblD2e1rblE1e1rblE2e1rblF1e1rblF2e1rblG1e1rblG2e1rblH1e1rblH2e1rblI1e1rblJ1e1rblK1e1rblL1e1rblM1e1rblN1e1rblO1e1rblP1
ECOD domains from experimental PDB structures interacting with ligand CAP
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00880 | n/a | CAP | 1rbl | e1rblA1 | A:11-147 |
| P00880 | n/a | CAP | 1rbl | e1rblA2 | A:151-475 |
| P00880 | n/a | CAP | 1rbl | e1rblB1 | B:11-147 |
| P00880 | n/a | CAP | 1rbl | e1rblB2 | B:151-475 |
| P00880 | n/a | CAP | 1rbl | e1rblC1 | C:11-147 |
| P00880 | n/a | CAP | 1rbl | e1rblC2 | C:151-475 |
| P00880 | n/a | CAP | 1rbl | e1rblD1 | D:11-147 |
| P00880 | n/a | CAP | 1rbl | e1rblD2 | D:151-475 |
| P00880 | n/a | CAP | 1rbl | e1rblE1 | E:11-147 |
| P00880 | n/a | CAP | 1rbl | e1rblE2 | E:151-475 |
| P00880 | n/a | CAP | 1rbl | e1rblF1 | F:11-147 |
| P00880 | n/a | CAP | 1rbl | e1rblF2 | F:151-475 |
| P00880 | n/a | CAP | 1rbl | e1rblG1 | G:11-147 |
| P00880 | n/a | CAP | 1rbl | e1rblG2 | G:151-475 |
| P00880 | n/a | CAP | 1rbl | e1rblH1 | H:11-147 |
| P00880 | n/a | CAP | 1rbl | e1rblH2 | H:151-475 |