Attributes
UniProt ID
Protein Name
Tryptophan--tRNA ligase
Ligand Name
ADENOSINE MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
UDMBCSSLTHHNCD-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3FHJ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3fhjA1e3fhjB1e3fhjC1e3fhjD1e3fhjE1e3fhjF1
ECOD domains from experimental PDB structures interacting with ligand DB00131
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00953 | DB00131 | AMP | 3fhj | e3fhjA1 | A:1-326 |
| P00953 | DB00131 | AMP | 3fhj | e3fhjB1 | B:1-326 |
| P00953 | DB00131 | AMP | 3fhj | e3fhjC1 | C:1-326 |
| P00953 | DB00131 | AMP | 3fhj | e3fhjD1 | D:1-326 |
| P00953 | DB00131 | AMP | 3fhj | e3fhjE1 | E:1-326 |
| P00953 | DB00131 | AMP | 3fhj | e3fhjF1 | F:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0A1 | A:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0B1 | B:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0C1 | C:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0D1 | D:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0E1 | E:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0F1 | F:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0G1 | G:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0H1 | H:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0I1 | I:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0J1 | J:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0K1 | K:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0L1 | L:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0M1 | M:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0N1 | N:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0O1 | O:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0P1 | P:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0Q1 | Q:1-326 |
| P00953 | DB00131 | AMP | 3fi0 | e3fi0R1 | R:1-326 |