Attributes
UniProt ID
Protein Name
Tryptophan--tRNA ligase
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1M83
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1m83A1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00953 | DB00171 | ATP | 1m83 | e1m83A1 | A:1-326 |
| P00953 | DB00171 | ATP | 1mau | e1mauA1 | A:1-326 |
| P00953 | DB00171 | ATP | 1maw | e1mawA1 | A:1-326 |
| P00953 | DB00171 | ATP | 1maw | e1mawB1 | B:1-326 |
| P00953 | DB00171 | ATP | 1maw | e1mawC1 | C:1-326 |
| P00953 | DB00171 | ATP | 1maw | e1mawD1 | D:1-326 |
| P00953 | DB00171 | ATP | 1maw | e1mawE1 | E:1-326 |
| P00953 | DB00171 | ATP | 1maw | e1mawF1 | F:1-326 |
| P00953 | DB00171 | ATP | 5dk4 | e5dk4A1 | A:0-327 |
| P00953 | DB00171 | ATP | 7cki | e7ckiA1 | A:1-326 |
| P00953 | DB00171 | ATP | 7eer | e7eerA1 | A:1-326 |
| P00953 | DB00171 | ATP | 7eer | e7eerB1 | B:1-326 |
| P00953 | DB00171 | ATP | 7eer | e7eerC1 | C:1-326 |
| P00953 | DB00171 | ATP | 7eer | e7eerD1 | D:1-326 |