Attributes
UniProt ID
Protein Name
Glutamine--tRNA ligase
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1GTR
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1gtrA1e1gtrA2e1gtrA3e1gtrA4e1gtrA5
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P00962 | DB00171 | ATP | 1gtr | e1gtrA2 | A:8-116,A:210-260 |
| P00962 | DB00171 | ATP | 1gtr | e1gtrA5 | A:261-338,A:454-547 |
| P00962 | DB00171 | ATP | 1qrs | e1qrsA4 | A:8-116,A:207-260 |
| P00962 | DB00171 | ATP | 1qrs | e1qrsA7 | A:261-344 |
| P00962 | DB00171 | ATP | 1qrt | e1qrtA4 | A:8-116,A:207-260 |
| P00962 | DB00171 | ATP | 1qrt | e1qrtA7 | A:261-344 |
| P00962 | DB00171 | ATP | 1qru | e1qruA4 | A:8-116,A:207-260 |
| P00962 | DB00171 | ATP | 1qru | e1qruA7 | A:261-344 |
| P00962 | DB00171 | ATP | 4jxx | e4jxxA3 | A:7-116,A:207-260 |
| P00962 | DB00171 | ATP | 4jxx | e4jxxA5 | A:261-344 |
| P00962 | DB00171 | ATP | 4jxz | e4jxzA3 | A:7-116,A:207-260 |
| P00962 | DB00171 | ATP | 4jxz | e4jxzA6 | A:261-344 |
| P00962 | DB00171 | ATP | 4jyz | e4jyzA3 | A:7-116,A:207-260 |
| P00962 | DB00171 | ATP | 4jyz | e4jyzA6 | A:261-344 |