Attributes
UniProt ID
Protein Name
GTPase HRas
Ligand Name
GUANOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XKMLYUALXHKNFT-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1NVU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1nvuQ1e1nvuR1e1nvuS1
ECOD domains from experimental PDB structures interacting with ligand DB04137
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P01112 | DB04137 | GTP | 1nvu | e1nvuQ1 | Q:1-166 |
| P01112 | DB04137 | GTP | 1nvx | e1nvxQ1 | Q:1-166 |
| P01112 | DB04137 | GTP | 1plk | e1plkA1 | A:1-166 |
| P01112 | DB04137 | GTP | 1qra | e1qraA1 | A:1-166 |
| P01112 | DB04137 | GTP | 2c5l | e2c5lA1 | A:1-166 |
| P01112 | DB04137 | GTP | 2c5l | e2c5lB1 | B:1-166 |
| P01112 | DB04137 | GTP | 2cl7 | e2cl7X1 | X:1-166 |
| P01112 | DB04137 | GTP | 2clc | e2clcX1 | X:1-166 |
| P01112 | DB04137 | GTP | 2uzi | e2uziR1 | R:1-166 |
| P01112 | DB04137 | GTP | 2vh5 | e2vh5R1 | R:1-166 |
| P01112 | DB04137 | GTP | 4k81 | e4k81B1 | B:-4-166 |
| P01112 | DB04137 | GTP | 4k81 | e4k81D1 | D:-4-166 |
| P01112 | DB04137 | GTP | 4k81 | e4k81F1 | F:-4-166 |
| P01112 | DB04137 | GTP | 4k81 | e4k81H1 | H:-4-166 |
| P01112 | DB04137 | GTP | 521p | e521pA1 | A:1-166 |