Attributes
UniProt ID
Protein Name
Polymeric immunoglobulin receptor
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5D4K
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5d4kA1e5d4kA2e5d4kA3e5d4kA4e5d4kA5e5d4kB1e5d4kB2e5d4kB3e5d4kB4e5d4kB5
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P01833 | DB00141 | NAG | 5d4k | e5d4kA1 | A:2-111 |
| P01833 | DB00141 | NAG | 5d4k | e5d4kA2 | A:445-549 |
| P01833 | DB00141 | NAG | 5d4k | e5d4kB1 | B:2-110 |
| P01833 | DB00141 | NAG | 5d4k | e5d4kB2 | B:444-549 |
| P01833 | DB00141 | NAG | 6ue7 | e6ue7C2 | C:331-443 |
| P01833 | DB00141 | NAG | 6ue7 | e6ue7C3 | C:444-546 |
| P01833 | DB00141 | NAG | 6ue7 | e6ue7C4 | C:2-109 |
| P01833 | DB00141 | NAG | 6ue8 | e6ue8C1 | C:2-110 |
| P01833 | DB00141 | NAG | 6ue9 | e6ue9C1 | C:331-443 |
| P01833 | DB00141 | NAG | 6ue9 | e6ue9C2 | C:444-547 |
| P01833 | DB00141 | NAG | 6ue9 | e6ue9C3 | C:2-110 |
| P01833 | DB00141 | NAG | 6uea | e6ueaC1 | C:444-547 |
| P01833 | DB00141 | NAG | 6uea | e6ueaC2 | C:331-443 |
| P01833 | DB00141 | NAG | 6uea | e6ueaC5 | C:2-109 |
| P01833 | DB00141 | NAG | 8sku | e8skuE1 | E:444-546 |
| P01833 | DB00141 | NAG | 8sku | e8skuE3 | E:2-110 |
| P01833 | DB00141 | NAG | 8sku | e8skuE5 | E:331-443 |
| P01833 | DB00141 | NAG | 8skv | e8skvE1 | E:2-110 |
| P01833 | DB00141 | NAG | 8skv | e8skvE2 | E:444-546 |
| P01833 | DB00141 | NAG | 8skv | e8skvE4 | E:331-443 |