Attributes
UniProt ID
Protein Name
Hemoglobin subunit beta
Ligand Name
PROTOPORPHYRIN IX CONTAINING FE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KABFMIBPWCXCRK-RGGAHWMASA-L
SMILES
Cc1c2n3c(c1CCC(=O)O)C=C4C(=C(C5=[N]4[Fe]36[N]7=C(C=C8N6C(=C5)C(=C8C)C=C)C(=C(C7=C2)C)C=C)C)CCC(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1G0B
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1g0bA1e1g0bB1
ECOD domains from experimental PDB structures interacting with ligand DB18267
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P02062 | DB18267 | HEM | 1g0b | e1g0bB1 | B:2-146 |
| P02062 | DB18267 | HEM | 1ibe | e1ibeB1 | B:2-146 |
| P02062 | DB18267 | HEM | 1iwh | e1iwhB1 | B:202-346 |
| P02062 | DB18267 | HEM | 1ns6 | e1ns6B1 | B:2-146 |
| P02062 | DB18267 | HEM | 1ns9 | e1ns9B1 | B:2-146 |
| P02062 | DB18267 | HEM | 1y8h | e1y8hB1 | B:2-146 |
| P02062 | DB18267 | HEM | 1y8h | e1y8hD1 | D:2-146 |
| P02062 | DB18267 | HEM | 1y8i | e1y8iB1 | B:2-146 |
| P02062 | DB18267 | HEM | 1y8i | e1y8iD1 | D:2-146 |
| P02062 | DB18267 | HEM | 1y8k | e1y8kB1 | B:2-146 |
| P02062 | DB18267 | HEM | 1y8k | e1y8kD1 | D:2-146 |
| P02062 | DB18267 | HEM | 2d5x | e2d5xB1 | B:2-146 |
| P02062 | DB18267 | HEM | 2dhb | e2dhbB1 | B:2-146 |
| P02062 | DB18267 | HEM | 2mhb | e2mhbB1 | B:2-146 |
| P02062 | DB18267 | HEM | 2zlt | e2zltB1 | B:2-145 |
| P02062 | DB18267 | HEM | 2zlu | e2zluB1 | B:2-145 |
| P02062 | DB18267 | HEM | 2zlv | e2zlvB1 | B:2-145 |
| P02062 | DB18267 | HEM | 2zlw | e2zlwB1 | B:2-145 |
| P02062 | DB18267 | HEM | 2zlw | e2zlwD1 | D:2-145 |
| P02062 | DB18267 | HEM | 2zlx | e2zlxB1 | B:2-145 |
| P02062 | DB18267 | HEM | 2zlx | e2zlxD1 | D:2-145 |
| P02062 | DB18267 | HEM | 5c6e | e5c6eB1 | B:1-146 |
| P02062 | DB18267 | HEM | 6r2o | e6r2oB1 | B:1-145 |
| P02062 | DB18267 | HEM | 6r2o | e6r2oD1 | D:1-145 |
| P02062 | DB18267 | HEM | 6sva | e6svaB1 | B:1-146 |
| P02062 | DB18267 | HEM | 8puq | e8puqB1 | B:1-146 |
| P02062 | DB18267 | HEM | 8pur | e8purB1 | B:1-146 |