Attributes
UniProt ID
Protein Name
Apolipoprotein A-I
Ligand Name
1,2-DIOLEOYL-SN-GLYCERO-3-PHOSPHOCHOLINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SNKAWJBJQDLSFF-NVKMUCNASA-O
SMILES
CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2MSC
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2mscA1e2mscB1e2mscC1
ECOD domains from experimental PDB structures interacting with ligand DB03690
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P02647 | DB03690 | PCW | 2msc | e2mscC1 | C:399-596 |
| P02647 | DB03690 | PCW | 2msd | e2msdC1 | C:399-596 |
| P02647 | DB03690 | PCW | 2mse | e2mseC1 | C:399-596 |
| P02647 | DB03690 | PCW | 6cc9 | e6cc9A1 | A:201-398 |
| P02647 | DB03690 | PCW | 6cc9 | e6cc9C1 | C:399-596 |
| P02647 | DB03690 | PCW | 6cch | e6cchA1 | A:201-398 |
| P02647 | DB03690 | PCW | 6cch | e6cchC1 | C:399-596 |
| P02647 | DB03690 | PCW | 6ccx | e6ccxA1 | A:201-398 |
| P02647 | DB03690 | PCW | 6ccx | e6ccxC1 | C:399-596 |
| P02647 | DB03690 | PCW | 6pts | e6ptsC1 | C:399-596 |
| P02647 | DB03690 | PCW | 6ptw | e6ptwA1 | A:201-398 |
| P02647 | DB03690 | PCW | 6ptw | e6ptwC1 | C:399-596 |
| P02647 | DB03690 | PCW | 6w4e | e6w4eA1 | A:201-398 |
| P02647 | DB03690 | PCW | 6w4e | e6w4eD1 | D:399-596 |
| P02647 | DB03690 | PCW | 6w4f | e6w4fA1 | A:201-398 |
| P02647 | DB03690 | PCW | 6w4f | e6w4fD1 | D:399-596 |