Attributes
UniProt ID
Protein Name
Band 3 anion transport protein
Ligand Name
[(2R)-2-octanoyloxy-3-[oxidanyl-[(1R,2R,3S,4R,5R,6S)-2,3,6-tris(oxidanyl)-4,5-diphosphonooxy-cyclohexyl]oxy-phosphoryl]oxy-propyl] octanoate
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XLNCEHRXXWQMPK-MJUMVPIBSA-N
SMILES
CCCCCCCC(=O)OCC(COP(=O)(O)OC1C(C(C(C(C1O)OP(=O)(O)O)OP(=O)(O)O)O)O)OC(=O)CCCCCCC
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7UZ3
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7uz3B1e7uz3C1e7uz3D1e7uz3E1
ECOD domains from experimental PDB structures interacting with ligand PIO
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P02730 | n/a | PIO | 7uz3 | e7uz3C1 | C:371-894 |
| P02730 | n/a | PIO | 7uz3 | e7uz3E1 | E:371-894 |
| P02730 | n/a | PIO | 7v07 | e7v07C1 | C:371-894 |
| P02730 | n/a | PIO | 7v07 | e7v07E1 | E:371-894 |
| P02730 | n/a | PIO | 7v0k | e7v0kO1 | O:351-894 |
| P02730 | n/a | PIO | 7v0k | e7v0kP1 | P:371-894 |
| P02730 | n/a | PIO | 7v19 | e7v19C1 | C:371-894 |
| P02730 | n/a | PIO | 7v19 | e7v19E1 | E:371-894 |
| P02730 | n/a | PIO | 8crq | e8crqC1 | C:371-894 |
| P02730 | n/a | PIO | 8crq | e8crqE1 | E:371-894 |
| P02730 | n/a | PIO | 8crr | e8crrC1 | C:371-894 |
| P02730 | n/a | PIO | 8crr | e8crrE1 | E:371-894 |
| P02730 | n/a | PIO | 8cs9 | e8cs9V1 | V:371-890 |
| P02730 | n/a | PIO | 8cs9 | e8cs9Y1 | Y:371-890 |
| P02730 | n/a | PIO | 8cs9 | e8cs9Z1 | Z:371-890 |
| P02730 | n/a | PIO | 8cs9 | e8cs9e1 | e:351-894 |
| P02730 | n/a | PIO | 8cs9 | e8cs9f1 | f:371-894 |
| P02730 | n/a | PIO | 8ct3 | e8ct3C1 | C:371-894 |
| P02730 | n/a | PIO | 8ct3 | e8ct3E1 | E:371-894 |
| P02730 | n/a | PIO | 8cte | e8cteP1 | P:351-894 |
| P02730 | n/a | PIO | 8cte | e8cteT1 | T:371-894 |