Attributes
UniProt ID
Protein Name
Serum amyloid P-component
Ligand Name
(2R)-1-[6-[(2R)-2-carboxypyrrolidin-1-yl]-6-oxidanylidene-hexanoyl]pyrrolidine-2-carboxylic acid
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HZLAWYIBLZNRFZ-VXGBXAGGSA-N
SMILES
C1CC(N(C1)C(=O)CCCCC(=O)N2CCCC2C(=O)O)C(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4AVT
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4avtA1e4avtB1e4avtC1e4avtD1e4avtE1e4avtF1e4avtG1e4avtH1e4avtI1e4avtJ1
ECOD domains from experimental PDB structures interacting with ligand DB13087
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P02743 | DB13087 | GHE | 4avt | e4avtA1 | A:1-204 |
| P02743 | DB13087 | GHE | 4avt | e4avtB1 | B:1-204 |
| P02743 | DB13087 | GHE | 4avt | e4avtC1 | C:1-204 |
| P02743 | DB13087 | GHE | 4avt | e4avtD1 | D:1-204 |
| P02743 | DB13087 | GHE | 4avt | e4avtE1 | E:1-204 |
| P02743 | DB13087 | GHE | 4avt | e4avtF1 | F:1-204 |
| P02743 | DB13087 | GHE | 4avt | e4avtG1 | G:1-204 |
| P02743 | DB13087 | GHE | 4avt | e4avtH1 | H:1-204 |
| P02743 | DB13087 | GHE | 4avt | e4avtI1 | I:1-204 |
| P02743 | DB13087 | GHE | 4avt | e4avtJ1 | J:1-204 |
| P02743 | DB13087 | GHE | 4avv | e4avvA1 | A:1-204 |
| P02743 | DB13087 | GHE | 4avv | e4avvB1 | B:1-204 |
| P02743 | DB13087 | GHE | 4avv | e4avvC1 | C:1-204 |
| P02743 | DB13087 | GHE | 4avv | e4avvD1 | D:1-204 |
| P02743 | DB13087 | GHE | 4avv | e4avvE1 | E:1-204 |