Attributes
UniProt ID
Protein Name
Lysine/arginine/ornithine-binding periplasmic protein
Ligand Name
ARGININE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ODKSFYDXXFIFQN-BYPYZUCNSA-O
SMILES
C(CC(C(=O)O)N)CNC(=[NH2+])N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1LAF
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1lafE1e1lafE2
ECOD domains from experimental PDB structures interacting with ligand DB00125
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P02911 | DB00125 | ARG | 1laf | e1lafE1 | E:1-90,E:191-238 |
| P02911 | DB00125 | ARG | 1laf | e1lafE2 | E:91-190 |
| P02911 | DB00125 | ARG | 6ft2 | e6ft2A1 | A:91-190 |
| P02911 | DB00125 | ARG | 6ft2 | e6ft2A2 | A:2-90,A:191-237 |
| P02911 | DB00125 | ARG | 6mku | e6mkuE1 | E:91-190 |
| P02911 | DB00125 | ARG | 6mku | e6mkuE2 | E:1-90,E:191-238 |
| P02911 | DB00125 | ARG | 6ml9 | e6ml9E1 | E:2-90,E:191-238 |
| P02911 | DB00125 | ARG | 6ml9 | e6ml9E2 | E:91-190 |
| P02911 | DB00125 | ARG | 6mla | e6mlaE1 | E:91-190 |
| P02911 | DB00125 | ARG | 6mla | e6mlaE2 | E:1-90,E:191-238 |
| P02911 | DB00125 | ARG | 6mle | e6mleE1 | E:91-190 |
| P02911 | DB00125 | ARG | 6mle | e6mleE2 | E:1-90,E:191-238 |
| P02911 | DB00125 | ARG | 6mlg | e6mlgE1 | E:91-190 |
| P02911 | DB00125 | ARG | 6mlg | e6mlgE2 | E:1-90,E:191-238 |
| P02911 | DB00125 | ARG | 6mln | e6mlnE1 | E:4-90,E:191-238 |
| P02911 | DB00125 | ARG | 6mln | e6mlnE2 | E:91-190 |
| P02911 | DB00125 | ARG | 6mlo | e6mloE1 | E:1-90,E:191-238 |
| P02911 | DB00125 | ARG | 6mlo | e6mloE2 | E:91-190 |