Attributes
UniProt ID
Protein Name
Light-harvesting protein B-870 alpha chain
Ligand Name
BACTERIOCHLOROPHYLL A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
DSJXIQQMORJERS-AGGZHOMASA-M
SMILES
CCC1C(C2=CC3=C(C(=C4[N-]3[Mg+2]56[N]2=C1C=C7[N-]5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C(=O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7YML
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7ymlA1e7ymlB1e7ymlD1e7ymlE1e7ymlF1e7ymlG1e7ymlH1e7ymlH2e7ymlI1e7ymlJ1e7ymlK1e7ymlL1e7ymlM1e7ymlN1e7ymlO1e7ymlP1e7ymlQ1e7ymlR1e7ymlS1e7ymlT1e7ymlV1e7ymlW1e7ymlY1e7ymlZ1
ECOD domains from experimental PDB structures interacting with ligand DB01853
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P02948 | DB01853 | BCL | 7yml | e7ymlA1 | A:1-44 |
| P02948 | DB01853 | BCL | 7yml | e7ymlD1 | D:1-56 |
| P02948 | DB01853 | BCL | 7yml | e7ymlF1 | F:1-54 |
| P02948 | DB01853 | BCL | 7yml | e7ymlI1 | I:1-56 |
| P02948 | DB01853 | BCL | 7yml | e7ymlK1 | K:1-55 |
| P02948 | DB01853 | BCL | 7yml | e7ymlO1 | O:1-56 |
| P02948 | DB01853 | BCL | 7yml | e7ymlQ1 | Q:1-56 |
| P02948 | DB01853 | BCL | 7yml | e7ymlS1 | S:1-56 |
| P02948 | DB01853 | BCL | 7yml | e7ymlV1 | V:1-56 |
| P02948 | DB01853 | BCL | 7yml | e7ymlY1 | Y:12-53 |
| P02948 | DB01853 | BCL | 8b64 | e8b64a1 | a:1-44 |
| P02948 | DB01853 | BCL | 8b64 | e8b64b1 | b:1-54 |
| P02948 | DB01853 | BCL | 8b64 | e8b64d1 | d:1-54 |
| P02948 | DB01853 | BCL | 8b64 | e8b64e1 | e:1-54 |
| P02948 | DB01853 | BCL | 8b64 | e8b64f1 | f:1-54 |
| P02948 | DB01853 | BCL | 8b64 | e8b64g1 | g:1-54 |
| P02948 | DB01853 | BCL | 8b64 | e8b64i1 | i:2-54 |
| P02948 | DB01853 | BCL | 8b64 | e8b64j1 | j:1-54 |
| P02948 | DB01853 | BCL | 8b64 | e8b64k1 | k:2-54 |
| P02948 | DB01853 | BCL | 8b64 | e8b64n1 | n:1-54 |
| P02948 | DB01853 | BCL | 8b64 | e8b64o1 | o:5-54 |
| P02948 | DB01853 | BCL | 8b64 | e8b64r1 | r:12-54 |
| P02948 | DB01853 | BCL | 8b64 | e8b64s1 | s:12-54 |
| P02948 | DB01853 | BCL | 8b64 | e8b64t1 | t:12-54 |
| P02948 | DB01853 | BCL | 8b64 | e8b64u1 | u:15-53 |