Attributes
UniProt ID
Protein Name
Light-harvesting protein B-870 beta chain
Ligand Name
BACTERIOCHLOROPHYLL A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
DSJXIQQMORJERS-AGGZHOMASA-M
SMILES
CCC1C(C2=CC3=C(C(=C4[N-]3[Mg+2]56[N]2=C1C=C7[N-]5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C(=O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7YML
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7ymlA1e7ymlB1e7ymlD1e7ymlE1e7ymlF1e7ymlG1e7ymlH1e7ymlH2e7ymlI1e7ymlJ1e7ymlK1e7ymlL1e7ymlM1e7ymlN1e7ymlO1e7ymlP1e7ymlQ1e7ymlR1e7ymlS1e7ymlT1e7ymlV1e7ymlW1e7ymlY1e7ymlZ1
ECOD domains from experimental PDB structures interacting with ligand DB01853
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P02950 | DB01853 | BCL | 7yml | e7ymlB1 | B:5-48 |
| P02950 | DB01853 | BCL | 7yml | e7ymlE1 | E:5-48 |
| P02950 | DB01853 | BCL | 7yml | e7ymlG1 | G:6-48 |
| P02950 | DB01853 | BCL | 7yml | e7ymlJ1 | J:5-48 |
| P02950 | DB01853 | BCL | 7yml | e7ymlN1 | N:6-48 |
| P02950 | DB01853 | BCL | 7yml | e7ymlP1 | P:6-48 |
| P02950 | DB01853 | BCL | 7yml | e7ymlR1 | R:6-48 |
| P02950 | DB01853 | BCL | 7yml | e7ymlT1 | T:6-48 |
| P02950 | DB01853 | BCL | 7yml | e7ymlW1 | W:8-48 |
| P02950 | DB01853 | BCL | 7yml | e7ymlZ1 | Z:18-48 |
| P02950 | DB01853 | BCL | 8b64 | e8b64A1 | A:6-49 |
| P02950 | DB01853 | BCL | 8b64 | e8b64B1 | B:6-49 |
| P02950 | DB01853 | BCL | 8b64 | e8b64D1 | D:6-49 |
| P02950 | DB01853 | BCL | 8b64 | e8b64E1 | E:6-49 |
| P02950 | DB01853 | BCL | 8b64 | e8b64F1 | F:8-49 |
| P02950 | DB01853 | BCL | 8b64 | e8b64G1 | G:8-49 |
| P02950 | DB01853 | BCL | 8b64 | e8b64I1 | I:8-49 |
| P02950 | DB01853 | BCL | 8b64 | e8b64J1 | J:7-49 |
| P02950 | DB01853 | BCL | 8b64 | e8b64K1 | K:7-49 |
| P02950 | DB01853 | BCL | 8b64 | e8b64N1 | N:8-49 |
| P02950 | DB01853 | BCL | 8b64 | e8b64O1 | O:8-49 |
| P02950 | DB01853 | BCL | 8b64 | e8b64R1 | R:12-49 |
| P02950 | DB01853 | BCL | 8b64 | e8b64S1 | S:13-49 |
| P02950 | DB01853 | BCL | 8b64 | e8b64T1 | T:13-49 |
| P02950 | DB01853 | BCL | 8b64 | e8b64U1 | U:20-45 |