Attributes
UniProt ID
Protein Name
n/a
Ligand Name
SPHEROIDENE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FJOCMTHZSURUFA-KXCOHNEYSA-N
SMILES
CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=CCC(C)(C)OC)C)C)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1F6N
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1f6nH1e1f6nH2e1f6nL1e1f6nM1
ECOD domains from experimental PDB structures interacting with ligand SPO
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P02953 | n/a | SPO | 1f6n | e1f6nM1 | M:1-302 |
| P02953 | n/a | SPO | 1fnp | e1fnpM1 | M:1-301 |
| P02953 | n/a | SPO | 1fnq | e1fnqM1 | M:1-302 |
| P02953 | n/a | SPO | 1jgw | e1jgwM1 | M:1-302 |
| P02953 | n/a | SPO | 1jgx | e1jgxM1 | M:1-302 |
| P02953 | n/a | SPO | 1jgy | e1jgyM1 | M:1-302 |
| P02953 | n/a | SPO | 1jgz | e1jgzM1 | M:1-302 |
| P02953 | n/a | SPO | 1jh0 | e1jh0M1 | M:1-301 |
| P02953 | n/a | SPO | 1kby | e1kbyM1 | M:1-302 |
| P02953 | n/a | SPO | 1m3x | e1m3xM1 | M:1-302 |
| P02953 | n/a | SPO | 1pcr | e1pcrM1 | M:1-302 |
| P02953 | n/a | SPO | 1rgn | e1rgnM1 | M:1-302 |
| P02953 | n/a | SPO | 1rvj | e1rvjM1 | M:1-301 |
| P02953 | n/a | SPO | 1ry5 | e1ry5M1 | M:1-301 |
| P02953 | n/a | SPO | 1rzh | e1rzhM1 | M:1-301 |
| P02953 | n/a | SPO | 1rzz | e1rzzM1 | M:3-301 |
| P02953 | n/a | SPO | 1rzz | e1rzzS1 | S:3-301 |
| P02953 | n/a | SPO | 1s00 | e1s00M1 | M:1-301 |
| P02953 | n/a | SPO | 1s00 | e1s00S1 | S:3-301 |
| P02953 | n/a | SPO | 1yf6 | e1yf6M1 | M:1-301 |
| P02953 | n/a | SPO | 1yst | e1ystM1 | M:1-303 |