Attributes
UniProt ID
Protein Name
Lactose operon repressor
Ligand Name
1-methylethyl 1-thio-beta-D-galactopyranoside
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BPHPUYQFMNQIOC-NXRLNHOXSA-N
SMILES
CC(C)SC1C(C(C(C(O1)CO)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1LBH
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1lbhA2e1lbhA3e1lbhB2e1lbhB3e1lbhC2e1lbhC3e1lbhD2e1lbhD3
ECOD domains from experimental PDB structures interacting with ligand DB01862
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P03023 | DB01862 | IPT | 1lbh | e1lbhA2 | A:161-291 |
| P03023 | DB01862 | IPT | 1lbh | e1lbhA3 | A:62-160,A:292-357 |
| P03023 | DB01862 | IPT | 1lbh | e1lbhB2 | B:161-291 |
| P03023 | DB01862 | IPT | 1lbh | e1lbhB3 | B:62-160,B:292-357 |
| P03023 | DB01862 | IPT | 1lbh | e1lbhC2 | C:161-291 |
| P03023 | DB01862 | IPT | 1lbh | e1lbhC3 | C:62-160,C:292-357 |
| P03023 | DB01862 | IPT | 1lbh | e1lbhD2 | D:161-291 |
| P03023 | DB01862 | IPT | 1lbh | e1lbhD3 | D:62-160,D:292-357 |
| P03023 | DB01862 | IPT | 1tlf | e1tlfA2 | A:161-291 |
| P03023 | DB01862 | IPT | 1tlf | e1tlfA3 | A:61-160,A:292-356 |
| P03023 | DB01862 | IPT | 1tlf | e1tlfB2 | B:161-291 |
| P03023 | DB01862 | IPT | 1tlf | e1tlfB3 | B:61-160,B:292-356 |
| P03023 | DB01862 | IPT | 1tlf | e1tlfC2 | C:161-291 |
| P03023 | DB01862 | IPT | 1tlf | e1tlfC3 | C:61-160,C:292-356 |
| P03023 | DB01862 | IPT | 1tlf | e1tlfD2 | D:161-291 |
| P03023 | DB01862 | IPT | 1tlf | e1tlfD3 | D:61-160,D:292-356 |
| P03023 | DB01862 | IPT | 2p9h | e2p9hA2 | A:162-291 |
| P03023 | DB01862 | IPT | 2p9h | e2p9hA3 | A:62-161,A:292-330 |
| P03023 | DB01862 | IPT | 2p9h | e2p9hB2 | B:162-291 |
| P03023 | DB01862 | IPT | 2p9h | e2p9hB3 | B:62-161,B:292-330 |