Attributes
UniProt ID
Protein Name
Lactose operon repressor
Ligand Name
2-nitrophenyl beta-D-fucopyranoside
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SWRPIVXPHLYETN-BVWHHUJWSA-N
SMILES
CC1C(C(C(C(O1)Oc2ccccc2[N+](=O)[O-])O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1EFA
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1efaA1e1efaA2e1efaA3e1efaB1e1efaB2e1efaB3e1efaC2e1efaC3
ECOD domains from experimental PDB structures interacting with ligand DB08297
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P03023 | DB08297 | NPF | 1efa | e1efaA2 | A:61-160,A:292-329 |
| P03023 | DB08297 | NPF | 1efa | e1efaA3 | A:161-291 |
| P03023 | DB08297 | NPF | 1efa | e1efaB1 | B:161-291 |
| P03023 | DB08297 | NPF | 1efa | e1efaB2 | B:61-160,B:292-331 |
| P03023 | DB08297 | NPF | 1efa | e1efaC2 | C:160-291 |
| P03023 | DB08297 | NPF | 1efa | e1efaC3 | C:46-160,C:292-331 |
| P03023 | DB08297 | NPF | 1jwl | e1jwlA1 | A:61-160,A:292-330 |
| P03023 | DB08297 | NPF | 1jwl | e1jwlA2 | A:161-291 |
| P03023 | DB08297 | NPF | 1jwl | e1jwlB1 | B:61-160,B:292-330 |
| P03023 | DB08297 | NPF | 1jwl | e1jwlB2 | B:161-291 |
| P03023 | DB08297 | NPF | 1jwl | e1jwlC2 | C:162-291 |
| P03023 | DB08297 | NPF | 1jwl | e1jwlC3 | C:62-161,C:292-330 |
| P03023 | DB08297 | NPF | 2paf | e2pafA2 | A:162-291 |
| P03023 | DB08297 | NPF | 2paf | e2pafA3 | A:62-161,A:292-330 |
| P03023 | DB08297 | NPF | 2paf | e2pafB2 | B:162-291 |
| P03023 | DB08297 | NPF | 2paf | e2pafB3 | B:62-161,B:292-330 |