Attributes
UniProt ID
Protein Name
Gag-Pol polyprotein
Ligand Name
(3R,3AS,6AR)-HEXAHYDROFURO[2,3-B]FURAN-3-YL(1S,2R)-3-[[(4-AMINOPHENYL)SULFONYL](ISOBUTYL)AMINO]-1-BENZYL-2-HYDROXYPROPYLCARBAMATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
CJBJHOAVZSMMDJ-HEXNFIEUSA-N
SMILES
CC(C)CN(CC(C(Cc1ccccc1)NC(=O)OC2COC3C2CCO3)O)S(=O)(=O)c4ccc(cc4)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1T3R
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1t3rA1e1t3rB1
ECOD domains from experimental PDB structures interacting with ligand DB01264
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P03369 | DB01264 | 017 | 1t3r | e1t3rA1 | A:1-99 |
| P03369 | DB01264 | 017 | 1t3r | e1t3rB1 | B:1-99 |
| P03369 | DB01264 | 017 | 3ekt | e3ektA1 | A:1-99 |
| P03369 | DB01264 | 017 | 3ekt | e3ektB1 | B:1-99 |
| P03369 | DB01264 | 017 | 3ekt | e3ektC1 | C:1-99 |
| P03369 | DB01264 | 017 | 3ekt | e3ektD1 | D:1-99 |
| P03369 | DB01264 | 017 | 3em6 | e3em6A1 | A:1-99 |
| P03369 | DB01264 | 017 | 3em6 | e3em6B1 | B:1-99 |
| P03369 | DB01264 | 017 | 3lzv | e3lzvA1 | A:1-99 |
| P03369 | DB01264 | 017 | 3lzv | e3lzvB1 | B:1-99 |
| P03369 | DB01264 | 017 | 3oxw | e3oxwA1 | A:1-99 |
| P03369 | DB01264 | 017 | 3oxw | e3oxwB1 | B:1-99 |
| P03369 | DB01264 | 017 | 3oxw | e3oxwC1 | C:1-99 |
| P03369 | DB01264 | 017 | 3oxw | e3oxwD1 | D:1-99 |
| P03369 | DB01264 | 017 | 3oy4 | e3oy4A1 | A:1-99 |
| P03369 | DB01264 | 017 | 3oy4 | e3oy4B1 | B:1-99 |