Attributes
UniProt ID
Protein Name
Gag-Pol polyprotein
Ligand Name
N-{(2S)-2-[(N-acetyl-L-threonyl-L-isoleucyl)amino]hexyl}-L-norleucyl-L-glutaminyl-N~5~-[amino(iminio)methyl]-L-ornithinamide
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MQPXOVRKKPPKFZ-QYKDHROSSA-O
SMILES
CCCCC(CNC(CCCC)C(=O)NC(CCC(=O)N)C(=O)NC(CCCNC(=[NH2+])N)C(=O)N)NC(=O)C(C(C)CC)NC(=O)C(C(C)O)NC(=O)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3FSM
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3fsmA1
ECOD domains from experimental PDB structures interacting with ligand 2NC
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P03369 | n/a | 2NC | 3fsm | e3fsmA1 | A:1-203 |
| P03369 | n/a | 2NC | 3hau | e3hauA1 | A:1-99 |
| P03369 | n/a | 2NC | 3hau | e3hauB1 | B:1-99 |
| P03369 | n/a | 2NC | 3haw | e3hawA1 | A:1-99 |
| P03369 | n/a | 2NC | 3haw | e3hawB1 | B:1-99 |
| P03369 | n/a | 2NC | 3hbo | e3hboA1 | A:1-99 |
| P03369 | n/a | 2NC | 3hbo | e3hboB1 | B:1-99 |
| P03369 | n/a | 2NC | 3hdk | e3hdkA1 | A:1-99 |
| P03369 | n/a | 2NC | 3hdk | e3hdkB1 | B:1-99 |
| P03369 | n/a | 2NC | 3hlo | e3hloA1 | A:1-203 |
| P03369 | n/a | 2NC | 3iaw | e3iawA1 | A:1-203 |
| P03369 | n/a | 2NC | 3ka2 | e3ka2A1 | A:1-203 |
| P03369 | n/a | 2NC | 3nwq | e3nwqA1 | A:1-99 |
| P03369 | n/a | 2NC | 3nwq | e3nwqB1 | B:1-99 |
| P03369 | n/a | 2NC | 3nyg | e3nygA1 | A:1-99 |
| P03369 | n/a | 2NC | 3nyg | e3nygB1 | B:1-99 |
| P03369 | n/a | 2NC | 4hvp | e4hvpA1 | A:1-99 |
| P03369 | n/a | 2NC | 4hvp | e4hvpB1 | B:1-99 |