Attributes
UniProt ID
Protein Name
Estrogen receptor
Ligand Name
4-HYDROXYTAMOXIFEN
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
TXUZVZSFRXZGTL-QPLCGJKRSA-N
SMILES
CCC(=C(c1ccc(cc1)O)c2ccc(cc2)OCCN(C)C)c3ccccc3
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2BJ4
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2bj4A1e2bj4B1
ECOD domains from experimental PDB structures interacting with ligand DB04468
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P03372 | DB04468 | OHT | 2bj4 | e2bj4A1 | A:305-528 |
| P03372 | DB04468 | OHT | 2bj4 | e2bj4B1 | B:304-529 |
| P03372 | DB04468 | OHT | 2jf9 | e2jf9A1 | A:305-528 |
| P03372 | DB04468 | OHT | 2jf9 | e2jf9B1 | B:305-529 |
| P03372 | DB04468 | OHT | 2jf9 | e2jf9C1 | C:305-529 |
| P03372 | DB04468 | OHT | 3ert | e3ertA1 | A:309-546 |
| P03372 | DB04468 | OHT | 4q50 | e4q50A1 | A:307-545 |
| P03372 | DB04468 | OHT | 4q50 | e4q50B1 | B:307-545 |
| P03372 | DB04468 | OHT | 4q50 | e4q50C1 | C:306-546 |
| P03372 | DB04468 | OHT | 4q50 | e4q50D1 | D:306-545 |
| P03372 | DB04468 | OHT | 4q50 | e4q50E1 | E:306-545 |
| P03372 | DB04468 | OHT | 4q50 | e4q50F1 | F:307-545 |
| P03372 | DB04468 | OHT | 4q50 | e4q50G1 | G:307-546 |
| P03372 | DB04468 | OHT | 4q50 | e4q50H1 | H:307-546 |
| P03372 | DB04468 | OHT | 5w9c | e5w9cA1 | A:309-547 |
| P03372 | DB04468 | OHT | 5w9c | e5w9cB1 | B:307-545 |
| P03372 | DB04468 | OHT | 5w9c | e5w9cC1 | C:309-547 |
| P03372 | DB04468 | OHT | 5w9c | e5w9cD1 | D:308-544 |
| P03372 | DB04468 | OHT | 6v87 | e6v87A1 | A:309-545 |
| P03372 | DB04468 | OHT | 6v87 | e6v87B1 | B:307-546 |
| P03372 | DB04468 | OHT | 7uj8 | e7uj8A1 | A:307-546 |
| P03372 | DB04468 | OHT | 7uj8 | e7uj8B1 | B:309-545 |