Attributes
UniProt ID
Protein Name
Hemagglutinin
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4NRJ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4nrjA1e4nrjB1e4nrjC1e4nrjD1e4nrjE1e4nrjF1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P03460 | DB00141 | NAG | 4nrj | e4nrjA1 | A:1-341 |
| P03460 | DB00141 | NAG | 4nrj | e4nrjB1 | B:1-170 |
| P03460 | DB00141 | NAG | 4nrj | e4nrjC1 | C:1-342 |
| P03460 | DB00141 | NAG | 4nrj | e4nrjD1 | D:1-169 |
| P03460 | DB00141 | NAG | 4nrj | e4nrjE1 | E:1-341 |
| P03460 | DB00141 | NAG | 4nrj | e4nrjF1 | F:1-168 |
| P03460 | DB00141 | NAG | 4nrk | e4nrkA1 | A:1-340 |
| P03460 | DB00141 | NAG | 4nrk | e4nrkB1 | B:1-168 |
| P03460 | DB00141 | NAG | 4nrk | e4nrkC1 | C:1-341 |
| P03460 | DB00141 | NAG | 4nrk | e4nrkD1 | D:1-168 |
| P03460 | DB00141 | NAG | 4nrk | e4nrkE1 | E:1-340 |
| P03460 | DB00141 | NAG | 4nrk | e4nrkF1 | F:1-168 |
| P03460 | DB00141 | NAG | 4nrl | e4nrlA1 | A:1-341 |
| P03460 | DB00141 | NAG | 4nrl | e4nrlB1 | B:1-170 |
| P03460 | DB00141 | NAG | 4nrl | e4nrlC1 | C:1-341 |
| P03460 | DB00141 | NAG | 4nrl | e4nrlD1 | D:1-169 |
| P03460 | DB00141 | NAG | 4nrl | e4nrlE1 | E:1-341 |
| P03460 | DB00141 | NAG | 4nrl | e4nrlF1 | F:1-169 |