Attributes
UniProt ID
Protein Name
Coagulation factor XI
Ligand Name
CITRIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KRKNYBCHXYNGOX-UHFFFAOYSA-N
SMILES
C(C(=O)O)C(CC(=O)O)(C(=O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3SOR
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3sorA1
ECOD domains from experimental PDB structures interacting with ligand DB04272
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P03951 | DB04272 | CIT | 3sor | e3sorA1 | A:388-623 |
| P03951 | DB04272 | CIT | 3sos | e3sosA1 | A:388-623 |
| P03951 | DB04272 | CIT | 4x6p | e4x6pA1 | A:16-243 |
| P03951 | DB04272 | CIT | 6vlu | e6vluA1 | A:388-623 |
| P03951 | DB04272 | CIT | 7v10 | e7v10A1 | A:388-623 |
| P03951 | DB04272 | CIT | 7v11 | e7v11A1 | A:388-623 |
| P03951 | DB04272 | CIT | 7v12 | e7v12A1 | A:388-623 |
| P03951 | DB04272 | CIT | 7v13 | e7v13A1 | A:388-623 |
| P03951 | DB04272 | CIT | 7v14 | e7v14A1 | A:388-623 |
| P03951 | DB04272 | CIT | 7v15 | e7v15A1 | A:388-623 |
| P03951 | DB04272 | CIT | 7v16 | e7v16A1 | A:388-623 |
| P03951 | DB04272 | CIT | 7v17 | e7v17A1 | A:388-623 |
| P03951 | DB04272 | CIT | 7v18 | e7v18A1 | A:388-623 |
| P03951 | DB04272 | CIT | 8bo3 | e8bo3AAA1 | AAA:388-623 |
| P03951 | DB04272 | CIT | 8bo5 | e8bo5AAA1 | AAA:388-623 |
| P03951 | DB04272 | CIT | 8bo6 | e8bo6AAA1 | AAA:388-624 |
| P03951 | DB04272 | CIT | 8bo7 | e8bo7AAA1 | AAA:388-623 |