Attributes
UniProt ID
Protein Name
Phosphatidylcholine-sterol acyltransferase
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4X96
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4x96A1e4x96B1e4x96C1e4x96D1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P04180 | DB00141 | NAG | 4x96 | e4x96A1 | A:22-396 |
| P04180 | DB00141 | NAG | 4x96 | e4x96B1 | B:22-396 |
| P04180 | DB00141 | NAG | 4x96 | e4x96C1 | C:22-396 |
| P04180 | DB00141 | NAG | 4x96 | e4x96D1 | D:22-396 |
| P04180 | DB00141 | NAG | 4xwg | e4xwgA1 | A:21-396 |
| P04180 | DB00141 | NAG | 4xx1 | e4xx1A1 | A:21-396 |
| P04180 | DB00141 | NAG | 4xx1 | e4xx1B1 | B:21-396 |
| P04180 | DB00141 | NAG | 4xx1 | e4xx1J1 | J:21-395 |
| P04180 | DB00141 | NAG | 5bv7 | e5bv7A1 | A:4-399 |
| P04180 | DB00141 | NAG | 5txf | e5txfA1 | A:20-399 |
| P04180 | DB00141 | NAG | 5txf | e5txfB1 | B:20-399 |
| P04180 | DB00141 | NAG | 5txf | e5txfC1 | C:20-399 |
| P04180 | DB00141 | NAG | 5txf | e5txfD1 | D:20-399 |
| P04180 | DB00141 | NAG | 6mvd | e6mvdA1 | A:21-398 |
| P04180 | DB00141 | NAG | 6mvd | e6mvdB1 | B:21-395 |