Attributes
UniProt ID
Protein Name
Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 -ATPase 1) ATPase
Ligand Name
SPIRO(2,4,6-TRINITROBENZENE[1,2A]-2O',3O'-METHYLENE-ADENINE-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XFMMHXLUHKBKQE-UHEGPQQHSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C4C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC5(O4)C(=CC(=[N+](O)[O-])C=C5[N+](=O)[O-])[N+](=O)[O-])N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3AR7
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3ar7A2e3ar7A4e3ar7A5e3ar7A7
ECOD domains from experimental PDB structures interacting with ligand DB02524
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P04191 | DB02524 | 128 | 3ar7 | e3ar7A4 | A:361-599 |
| P04191 | DB02524 | 128 | 3ar7 | e3ar7A5 | A:344-360,A:600-750 |
| P04191 | DB02524 | 128 | 3ar7 | e3ar7A7 | A:125-239 |
| P04191 | DB02524 | 128 | 5a3s | e5a3sA1 | A:361-599 |
| P04191 | DB02524 | 128 | 5a3s | e5a3sA2 | A:125-239 |
| P04191 | DB02524 | 128 | 5a3s | e5a3sA4 | A:344-360,A:600-750 |
| P04191 | DB02524 | 128 | 5a3s | e5a3sB2 | B:344-360,B:600-750 |
| P04191 | DB02524 | 128 | 5a3s | e5a3sB3 | B:361-599 |
| P04191 | DB02524 | 128 | 5a3s | e5a3sB4 | B:125-239 |
| P04191 | DB02524 | 128 | 5ncq | e5ncqA2 | A:344-360,A:600-750 |
| P04191 | DB02524 | 128 | 5ncq | e5ncqA3 | A:361-599 |
| P04191 | DB02524 | 128 | 6yaa | e6yaaA2 | A:344-360,A:600-750 |
| P04191 | DB02524 | 128 | 6yaa | e6yaaA3 | A:361-599 |
| P04191 | DB02524 | 128 | 6yaa | e6yaaA4 | A:125-239 |
| P04191 | DB02524 | 128 | 6yso | e6ysoA1 | A:344-360,A:600-750 |
| P04191 | DB02524 | 128 | 6yso | e6ysoA3 | A:361-599 |
| P04191 | DB02524 | 128 | 6yso | e6ysoA4 | A:125-239 |
| P04191 | DB02524 | 128 | 6yso | e6ysoB1 | B:344-360,B:600-750 |
| P04191 | DB02524 | 128 | 6yso | e6ysoB2 | B:125-239 |
| P04191 | DB02524 | 128 | 6yso | e6ysoB4 | B:361-599 |