Attributes
UniProt ID
Protein Name
Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 -ATPase 1) ATPase
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1T5T
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1t5tA1e1t5tA4e1t5tA5e1t5tA6
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P04191 | DB16833 | ADP | 1t5t | e1t5tA4 | A:361-599 |
| P04191 | DB16833 | ADP | 1t5t | e1t5tA5 | A:344-360,A:600-750 |
| P04191 | DB16833 | ADP | 1wpg | e1wpgA1 | A:125-239 |
| P04191 | DB16833 | ADP | 1wpg | e1wpgA4 | A:361-599 |
| P04191 | DB16833 | ADP | 1wpg | e1wpgB1 | B:125-239 |
| P04191 | DB16833 | ADP | 1wpg | e1wpgB4 | B:361-599 |
| P04191 | DB16833 | ADP | 1wpg | e1wpgC1 | C:125-239 |
| P04191 | DB16833 | ADP | 1wpg | e1wpgC4 | C:361-599 |
| P04191 | DB16833 | ADP | 1wpg | e1wpgD1 | D:125-239 |
| P04191 | DB16833 | ADP | 1wpg | e1wpgD4 | D:361-599 |
| P04191 | DB16833 | ADP | 2oa0 | e2oa0A3 | A:344-360,A:600-750 |
| P04191 | DB16833 | ADP | 2oa0 | e2oa0A7 | A:361-599 |
| P04191 | DB16833 | ADP | 2zbd | e2zbdA4 | A:361-599 |
| P04191 | DB16833 | ADP | 2zbd | e2zbdA5 | A:344-360,A:600-750 |
| P04191 | DB16833 | ADP | 3ar3 | e3ar3A4 | A:361-599 |
| P04191 | DB16833 | ADP | 3ar3 | e3ar3A5 | A:344-360,A:600-750 |
| P04191 | DB16833 | ADP | 3ar3 | e3ar3A7 | A:125-239 |
| P04191 | DB16833 | ADP | 3fps | e3fpsA4 | A:361-599 |
| P04191 | DB16833 | ADP | 3fps | e3fpsA5 | A:344-360,A:600-750 |
| P04191 | DB16833 | ADP | 5xa8 | e5xa8A3 | A:361-599 |
| P04191 | DB16833 | ADP | 5xa8 | e5xa8A4 | A:344-360,A:600-750 |