Attributes
UniProt ID
Protein Name
DNA alpha-glucosyltransferase
Ligand Name
URIDINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XCCTYIAWTASOJW-XVFCMESISA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1XV5
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1xv5A1e1xv5A2
ECOD domains from experimental PDB structures interacting with ligand DB03435
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P04519 | DB03435 | UDP | 1xv5 | e1xv5A1 | A:1000-1177 |
| P04519 | DB03435 | UDP | 1xv5 | e1xv5A2 | A:1178-1400 |
| P04519 | DB03435 | UDP | 1y6f | e1y6fB1 | B:1178-1400 |
| P04519 | DB03435 | UDP | 1y6f | e1y6fB2 | B:999-1177 |
| P04519 | DB03435 | UDP | 1y6g | e1y6gA1 | A:998-1177 |
| P04519 | DB03435 | UDP | 1y6g | e1y6gA2 | A:1178-1400 |
| P04519 | DB03435 | UDP | 1y6g | e1y6gB1 | B:1178-1400 |
| P04519 | DB03435 | UDP | 1y6g | e1y6gB2 | B:998-1177 |
| P04519 | DB03435 | UDP | 1y8z | e1y8zA1 | A:1178-1400 |
| P04519 | DB03435 | UDP | 1y8z | e1y8zA2 | A:999-1177 |
| P04519 | DB03435 | UDP | 1y8z | e1y8zB1 | B:1178-1400 |
| P04519 | DB03435 | UDP | 1y8z | e1y8zB2 | B:999-1141,B:1171-1177 |
| P04519 | DB03435 | UDP | 1ya6 | e1ya6A1 | A:1178-1400 |
| P04519 | DB03435 | UDP | 1ya6 | e1ya6A2 | A:1000-1147,A:1169-1177 |
| P04519 | DB03435 | UDP | 1ya6 | e1ya6B1 | B:998-1142,B:1169-1177 |
| P04519 | DB03435 | UDP | 1ya6 | e1ya6B2 | B:1178-1400 |