Attributes
UniProt ID
Protein Name
Gag-Pol polyprotein
Ligand Name
N-{(2S)-2-[(N-acetyl-L-threonyl-L-isoleucyl)amino]hexyl}-L-norleucyl-L-glutaminyl-N~5~-[amino(iminio)methyl]-L-ornithinamide
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MQPXOVRKKPPKFZ-QYKDHROSSA-O
SMILES
CCCCC(CNC(CCCC)C(=O)NC(CCC(=O)N)C(=O)NC(CCCNC(=[NH2+])N)C(=O)N)NC(=O)C(C(C)CC)NC(=O)C(C(C)O)NC(=O)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1FEJ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1fejC1e1fejD1
ECOD domains from experimental PDB structures interacting with ligand 2NC
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P04587 | n/a | 2NC | 1fej | e1fejC1 | C:1-99 |
| P04587 | n/a | 2NC | 1fej | e1fejD1 | D:101-199 |
| P04587 | n/a | 2NC | 1ff0 | e1ff0C1 | C:1-99 |
| P04587 | n/a | 2NC | 1ff0 | e1ff0D1 | D:101-199 |
| P04587 | n/a | 2NC | 1ffi | e1ffiC1 | C:1-99 |
| P04587 | n/a | 2NC | 1ffi | e1ffiD1 | D:101-199 |
| P04587 | n/a | 2NC | 1fg6 | e1fg6C1 | C:1-99 |
| P04587 | n/a | 2NC | 1fg6 | e1fg6D1 | D:101-199 |
| P04587 | n/a | 2NC | 1fgc | e1fgcC1 | C:1-99 |
| P04587 | n/a | 2NC | 1fgc | e1fgcD1 | D:101-199 |
| P04587 | n/a | 2NC | 2aoc | e2aocA1 | A:1-99 |
| P04587 | n/a | 2NC | 2aoc | e2aocB1 | B:101-199 |
| P04587 | n/a | 2NC | 2aod | e2aodA1 | A:1-99 |
| P04587 | n/a | 2NC | 2aod | e2aodB1 | B:101-199 |
| P04587 | n/a | 2NC | 2aog | e2aogA1 | A:1-99 |
| P04587 | n/a | 2NC | 2aog | e2aogB1 | B:101-199 |
| P04587 | n/a | 2NC | 2avm | e2avmA1 | A:1-99 |
| P04587 | n/a | 2NC | 2avm | e2avmB1 | B:1-99 |
| P04587 | n/a | 2NC | 2avq | e2avqA1 | A:1-99 |
| P04587 | n/a | 2NC | 2avq | e2avqB1 | B:1-99 |