Attributes
UniProt ID
Protein Name
Chlorophyll a-b binding protein 1, chloroplastic
Ligand Name
CHLOROPHYLL A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ATNHDLDRLWWWCB-AENOIHSZSA-M
SMILES
CCC1=C(C2=Cc3c(c(c4n3[Mg]56[N]2=C1C=C7N5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C=C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5MDX
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5mdx11e5mdx21e5mdx31e5mdx41e5mdx51e5mdx61e5mdx71e5mdx81e5mdxA1e5mdxB1e5mdxB2e5mdxC1e5mdxD1e5mdxE1e5mdxF1e5mdxG1e5mdxH1e5mdxI1e5mdxK1e5mdxL1e5mdxM1e5mdxN1e5mdxO1e5mdxR1e5mdxS1e5mdxT1e5mdxW1e5mdxX1e5mdxY1e5mdxZ1e5mdxa1e5mdxb1e5mdxb2e5mdxc1e5mdxd1e5mdxe1e5mdxf1e5mdxg1e5mdxh1e5mdxi1e5mdxk1e5mdxl1e5mdxm1e5mdxn1e5mdxo1e5mdxr1e5mdxs1e5mdxt1e5mdxw1e5mdxx1e5mdxy1e5mdxz1
ECOD domains from experimental PDB structures interacting with ligand DB02133
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P04778 | DB02133 | CLA | 5mdx | e5mdx11 | 1:48-266 |
| P04778 | DB02133 | CLA | 5mdx | e5mdx21 | 2:48-266 |
| P04778 | DB02133 | CLA | 5mdx | e5mdx31 | 3:48-266 |
| P04778 | DB02133 | CLA | 5mdx | e5mdx51 | 5:48-266 |
| P04778 | DB02133 | CLA | 5mdx | e5mdx61 | 6:48-266 |
| P04778 | DB02133 | CLA | 5mdx | e5mdx71 | 7:48-266 |
| P04778 | DB02133 | CLA | 5mdx | e5mdxG1 | G:48-266 |
| P04778 | DB02133 | CLA | 5mdx | e5mdxN1 | N:48-266 |
| P04778 | DB02133 | CLA | 5mdx | e5mdxY1 | Y:48-266 |
| P04778 | DB02133 | CLA | 5mdx | e5mdxg1 | g:48-266 |
| P04778 | DB02133 | CLA | 5mdx | e5mdxn1 | n:48-266 |
| P04778 | DB02133 | CLA | 5mdx | e5mdxy1 | y:48-266 |
| P04778 | DB02133 | CLA | 7oui | e7ouiG1 | G:47-252 |
| P04778 | DB02133 | CLA | 7oui | e7ouiN1 | N:48-249 |
| P04778 | DB02133 | CLA | 7oui | e7ouiY1 | Y:47-259 |
| P04778 | DB02133 | CLA | 7oui | e7ouig1 | g:47-252 |
| P04778 | DB02133 | CLA | 7oui | e7ouin1 | n:48-249 |
| P04778 | DB02133 | CLA | 7oui | e7ouiy1 | y:47-259 |