Attributes
UniProt ID
Protein Name
Cytochrome P450 1A1
Ligand Name
PROTOPORPHYRIN IX CONTAINING FE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KABFMIBPWCXCRK-RGGAHWMASA-L
SMILES
Cc1c2n3c(c1CCC(=O)O)C=C4C(=C(C5=[N]4[Fe]36[N]7=C(C=C8N6C(=C5)C(=C8C)C=C)C(=C(C7=C2)C)C=C)C)CCC(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4I8V
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4i8vA1e4i8vB1e4i8vC1e4i8vD1
ECOD domains from experimental PDB structures interacting with ligand DB18267
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P04798 | DB18267 | HEM | 4i8v | e4i8vA1 | A:36-512 |
| P04798 | DB18267 | HEM | 4i8v | e4i8vB1 | B:30-499 |
| P04798 | DB18267 | HEM | 4i8v | e4i8vC1 | C:28-495 |
| P04798 | DB18267 | HEM | 4i8v | e4i8vD1 | D:28-494 |
| P04798 | DB18267 | HEM | 6dwm | e6dwmA1 | A:35-512 |
| P04798 | DB18267 | HEM | 6dwm | e6dwmB1 | B:37-512 |
| P04798 | DB18267 | HEM | 6dwm | e6dwmC1 | C:38-512 |
| P04798 | DB18267 | HEM | 6dwm | e6dwmD1 | D:39-512 |
| P04798 | DB18267 | HEM | 6dwn | e6dwnA1 | A:37-512 |
| P04798 | DB18267 | HEM | 6dwn | e6dwnB1 | B:36-512 |
| P04798 | DB18267 | HEM | 6dwn | e6dwnC1 | C:38-512 |
| P04798 | DB18267 | HEM | 6dwn | e6dwnD1 | D:38-512 |
| P04798 | DB18267 | HEM | 6o5y | e6o5yA1 | A:36-512 |
| P04798 | DB18267 | HEM | 6o5y | e6o5yB1 | B:37-512 |
| P04798 | DB18267 | HEM | 6o5y | e6o5yC1 | C:36-512 |
| P04798 | DB18267 | HEM | 6o5y | e6o5yD1 | D:39-512 |
| P04798 | DB18267 | HEM | 6udl | e6udlA1 | A:36-512 |
| P04798 | DB18267 | HEM | 6udl | e6udlB1 | B:36-512 |
| P04798 | DB18267 | HEM | 6udl | e6udlC1 | C:36-512 |
| P04798 | DB18267 | HEM | 6udl | e6udlD1 | D:36-512 |
| P04798 | DB18267 | HEM | 6udm | e6udmA1 | A:37-512 |
| P04798 | DB18267 | HEM | 6udm | e6udmB1 | B:37-512 |
| P04798 | DB18267 | HEM | 6udm | e6udmC1 | C:37-512 |
| P04798 | DB18267 | HEM | 6udm | e6udmD1 | D:37-512 |