Attributes
UniProt ID
Protein Name
Glutathione S-transferase Mu 1
Ligand Name
(9R,10R)-9-(S-GLUTATHIONYL)-10-HYDROXY-9,10-DIHYDROPHENANTHRENE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
JNNIZILNBMPOAC-MOXQZVSFSA-N
SMILES
c1ccc2c(c1)-c3ccccc3C(C2O)SCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1MTC
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1mtcA1e1mtcA2e1mtcB1e1mtcB2
ECOD domains from experimental PDB structures interacting with ligand DB01834
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P04905 | DB01834 | GPR | 1mtc | e1mtcA1 | A:85-217 |
| P04905 | DB01834 | GPR | 1mtc | e1mtcA2 | A:1-84 |
| P04905 | DB01834 | GPR | 1mtc | e1mtcB1 | B:85-217 |
| P04905 | DB01834 | GPR | 1mtc | e1mtcB2 | B:1-84 |
| P04905 | DB01834 | GPR | 3fyg | e3fygA1 | A:85-217 |
| P04905 | DB01834 | GPR | 3fyg | e3fygA2 | A:1-84 |
| P04905 | DB01834 | GPR | 3fyg | e3fygB1 | B:85-217 |
| P04905 | DB01834 | GPR | 3fyg | e3fygB2 | B:1-84 |
| P04905 | DB01834 | GPR | 3gst | e3gstA1 | A:85-217 |
| P04905 | DB01834 | GPR | 3gst | e3gstA2 | A:1-84 |
| P04905 | DB01834 | GPR | 3gst | e3gstB1 | B:85-217 |
| P04905 | DB01834 | GPR | 3gst | e3gstB2 | B:1-84 |
| P04905 | DB01834 | GPR | 5fwg | e5fwgA1 | A:85-217 |
| P04905 | DB01834 | GPR | 5fwg | e5fwgA2 | A:1-84 |
| P04905 | DB01834 | GPR | 5fwg | e5fwgB1 | B:85-217 |
| P04905 | DB01834 | GPR | 5fwg | e5fwgB2 | B:1-84 |